| Verifiedfields | changed |
|---|---|
| Verifiedrevid | 449582436 |
| Iupac name | (RS)-2-methoxy-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine |
| Cas number | 15221-81-5 |
| Atc prefix | none |
| Pubchem | 27139 |
| Unii | 346FQP00BI |
| Kegg | D04205 |
| Chemspiderid | 25259 |
| C | 11 |
| H | 14 |
| F | 3 |
| N | 1 |
| O | 1 |
| Smiles | CNCC(C1=CC(=CC=C1)C(F)(F)F)OC |
| Stdinchi | 1S/C11H14F3NO/c1-15-7-10(16-2)8-4-3-5-9(6-8)11(12,13)14/h3-6,10,15H,7H2,1-2H3 |
| Stdinchikey | CXLOIJUDIPVKOU-UHFFFAOYSA-N |
Fludorex is a stimulant anorexic agent of the phenethylamine chemical class.[1]
References
- ^ Beregi SL, Duhault J (1977). "Structure-anorectic activity relationships in substituted phenethylamines". Arzneimittel-Forschung. 27 (1): 116–8. PMID 576809