{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 440125718 | Name = Fertaric acid | ImageFile = Fertaric acid.svg | ImageSize = 200px | ImageCaption = (2''S'',3''S'')-stereoisomer | ImageName = Chemical structure of fertaric acid | ImageAlt = Chemical structure of fertaric acid | IUPACName = 2-Hydroxy-3-<nowiki>{[(</nowiki>2''E'')-3-(4-hydroxy-3methoxyphenyl)prop-2-enoyl]oxy}butandioic acid | OtherNames = <!-- <br> --> |Section1={{Chembox Identifiers | CASNo1 = 74282-22-7 | CASNo_Ref = | CASNoOther = | PubChem = 22298372 | ChEBI1 = 76120 | index1_label = 2S,3S,trans | ChEBI2 = 76118 | index2_label = 2S,3S,cis | ChEBI3 = 76116 | index3_label = 2R,3R,trans | ChEBI4 = 76115 | index4_label = 2R,3R,cis | MeSHName = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 20058463 | PubChem1 = 641605 | InChI = 1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+ | InChI1=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+/t11-,12-/m0/s1 | InChIKey = XIWXUSFCUBAMFH-HWKANZROSA-N | InChIKey1 = XIWXUSFCUBAMFH-SCBUBVSKSA-N | SMILES = Oc1ccc(cc1OC)/C=C/C(=O)OC(C(=O)O)C(O)C(=O)O | SMILES1 = COC1=C(C=CC(=C1)/C=C/C(=O)O[C@@H]([C@@H](C(=O)O)O)C(=O)O)O }} |Section2={{Chembox Properties | C=14 | H=14 | O=9 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | GHS_ref =<!-- no GHS data in PubChem Dec2021 --> }} }}
'''Fertaric acid''' is a hydroxycinnamic acid found in wine and grapes.<ref>{{Cite journal|url=http://acta.chem-soc.si/53/53-1-58.pdf |title=Determination of Polyphenols in White grape Berries cv. Rebula |author1=Branka Mozetič |author2=Irma Tomažič |author3=Andreja Škvarč |author4=Polonca Trebše |journal=Acta Chim. Slov. |year=2006 |volume=53 |pages=58–64 |url-status=dead |archiveurl=https://web.archive.org/web/20110807035647/http://acta.chem-soc.si/53/53-1-58.pdf |archivedate=2011-08-07 }}</ref> It is an ester formed from ferulic acid bound to tartaric acid.
It is a metabolite of caftaric acid after caftaric acid has been fed to rats. Fertaric acid is then found in plasma, kidney, and urine.<ref name=Vanzo>{{Cite journal|pmid=17300159|year=2007|last1=Vanzo|first1=A|last2=Cecotti|first2=R|last3=Vrhovsek|first3=U|last4=Torres|first4=AM|last5=Mattivi|first5=F|last6=Passamonti|first6=S|title=The fate of trans-caftaric acid administered into the rat stomach|volume=55|issue=4|pages=1604–11|doi=10.1021/jf0626819|journal=Journal of Agricultural and Food Chemistry|bibcode=2007JAFC...55.1604V }}</ref>
== References == {{reflist}}
{{Hydroxycinnamic acid}}
Category:O-methylated hydroxycinnamic acids Category:Hydroxycinnamic acid esters Category:Dicarboxylic acids Category:Alpha hydroxycarboxylic acids
{{aromatic-stub}}