{{Short description|Pharmaceutical drug}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443819210 | IUPAC_name = [8-Methyl-8-[2-oxo-2-(4-phenylphenyl)ethyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate bromide | image = Fentonium bromide.svg | image_class = skin-invert-image | width = 200
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = 1 | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 5868-06-4 | ATC_prefix = A03 | ATC_suffix = BB04 | PubChem = 71534 | DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank = DB08978 | KEGG = D07951 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = XS152O7VCZ | ChemSpiderID = 64607
<!--Chemical data--> | C=31 | H=34 | Br=1 | N=1 | O=4 | StdInChI=1S/C31H34NO4.BrH/c1-32(20-30(34)25-14-12-23(13-15-25)22-8-4-2-5-9-22)26-16-17-27(32)19-28(18-26)36-31(35)29(21-33)24-10-6-3-7-11-24;/h2-15,26-29,33H,16-21H2,1H3;1H/q+1;/p-1 | StdInChIKey = MPLNGQBULSHWQW-UHFFFAOYSA-M | SMILES = C[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)CC(=O)C4=CC=C(C=C4)C5=CC=CC=C5.[Br-] }}
'''Fentonium bromide''' (INN) is an anticholinergic and antispasmodic atropine derivative.<ref>{{cite book | vauthors = Milne GW |title=Drugs: Synonyms and Properties |date=2002 |publisher=Ashgate |location=Aldershot, Hampshire, England |isbn=978-0-566-08491-1 |page=2785 |edition=2nd | chapter = Fentonium bromide | chapter-url=https://books.google.com/books?id=QxcoEAAAQBAJ&dq=Fentonium+bromide&pg=PA213}}</ref> In the US its patent number is 3,356,682.<ref>{{cite web |title= Fentonium|url=https://www.drugbank.ca/drugs/DB08978 |website=DrugBank|access-date=19 December 2016|date=17 August 2016}}</ref> It is sold by Sanofi-Aventis and Zambon.<ref>{{cite web |title=Ulcesium (fentonium bromide) drug & pharmaceuticals. Ulcesium available forms, doses, prices |url=https://www.sdrugs.com/?c=drug&s=ulcesium&ingredient=fentonium%20bromide |website = sdrugs.com |access-date=19 December 2016}}</ref>
==References== {{reflist}}
{{Drugs for functional gastrointestinal disorders}} {{Muscarinic acetylcholine receptor modulators}}
Category:Tropanes Category:Quaternary ammonium compounds Category:Bromides Category:Aromatic ketones Category:Primary alcohols Category:Carboxylate esters Category:Biphenyls Category:Muscarinic antagonists
{{gastrointestinal-drug-stub}}