{{Short description|Somatostatin release enhancer}} {{Drugbox | IUPAC_name = N-(1-acetylpiperidin-4-yl)-4-fluorobenzamide | image = FK962_structure.png | image_class = skin-invert-image
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = | legal_DE = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 283167-06-6 | UNII = 25J7VT36F9 | ATC_prefix = | ATC_suffix = | PubChem = 9816738 | ChemSpiderID = 7992488 | ChEMBL = 4303387 | smiles = CC(=O)N1CCC(CC1)NC(=O)C2=CC=C(C=C2)F | StdInChI = 1S/C14H17FN2O2/c1-10(18)17-8-6-13(7-9-17)16-14(19)11-2-4-12(15)5-3-11/h2-5,13H,6-9H2,1H3,(H,16,19) | StdInChIKey = VBHVOHJOTMCSBQ-UHFFFAOYSA-N
<!--Chemical data--> | C=14 | H=17 | F=1 | N=2 | O=2 }}
'''FK962''' is a compound which acts as an enhancer of somatostatin release. It stimulates nerve growth and neurite elongation, and has been researched in animal models for potential applications in the treatment of conditions such as Alzheimer's disease and retinal neuropathy.<ref>{{cite journal | vauthors = Tokita K, Inoue T, Yamazaki S, Wang F, Yamaji T, Matsuoka N, Mutoh S | title = FK962, a novel enhancer of somatostatin release, exerts cognitive-enhancing actions in rats | journal = European Journal of Pharmacology | volume = 527 | issue = 1–3 | pages = 111–120 | date = December 2005 | pmid = 16325809 | doi = 10.1016/j.ejphar.2005.10.022 }}</ref><ref>{{cite journal | vauthors = McCarthy AD, Owens IJ, Bansal AT, McTighe SM, Bussey TJ, Saksida LM | title = FK962 and donepezil act synergistically to improve cognition in rats: potential as an add-on therapy for Alzheimer's disease | journal = Pharmacology, Biochemistry, and Behavior | volume = 98 | issue = 1 | pages = 76–80 | date = March 2011 | pmid = 21130801 | doi = 10.1016/j.pbb.2010.11.019 | s2cid = 26055819 }}</ref><ref>{{cite journal | vauthors = Kishimoto Y, Yabuta C, Shearer TR, Azuma M | title = FK962 promotes neurite elongation and regeneration of cultured rat trigeminal ganglion cells: possible involvement of GDNF | journal = Investigative Ophthalmology & Visual Science | volume = 53 | issue = 9 | pages = 5312–5319 | date = August 2012 | pmid = 22714891 | doi = 10.1167/iovs.11-8957 }}</ref><ref>{{cite journal | vauthors = Nakajima E, Walkup RD, Shearer TR, Azuma M | title = FK962 induces neurite outgrowth in cultured monkey trigeminal ganglion cells | journal = Graefe's Archive for Clinical and Experimental Ophthalmology = Albrecht von Graefes Archiv für Klinische und Experimentelle Ophthalmologie | volume = 255 | issue = 1 | pages = 107–112 | date = January 2017 | pmid = 27778122 | doi = 10.1007/s00417-016-3525-5 | s2cid = 26043647 }}</ref>
== See also == * Octreotide * Pasireotide * Sunifiram (structural similarity)
== References == {{reflist}}
{{systemic-hormonal-drug-stub}}
Category:Pharmacology Category:Acetamides Category:Benzamides Category:Piperidines Category:4-Fluorophenyl compounds