{{chembox | verifiedrevid = 424980388 |ImageFile=FC-75.png |ImageSize= |IUPACName= <small>2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)tetrahydrofuran</small> |OtherNames=Perfluorocyclic ether, Fluorinert FC-75,<br>Perfluoro-compound FC-75,<br>Perfluoro-2-n-butyl THF,<br>Perfluoro(butyltetrahydrofuran) |Section1= {{Chembox Identifiers | Abbreviations=PFBTHF | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=335-36-4 | Beilstein = 341263 | ChEBI = 39023 | ChemSpiderID = 71309 | EINECS=206-389-5 | PubChem=78976 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = MSL8VN7XHA | StdInChI=1S/C8F16O/c9-1(10,4(15,16)7(20,21)22)2(11,12)6(19)3(13,14)5(17,18)8(23,24)25-6 | StdInChIKey = FYJQJMIEZVMYSD-UHFFFAOYSA-N | SMILES=C1(C(C(OC1(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(F)F }} |Section2= {{Chembox Properties | Formula=C<sub>8</sub>F<sub>16</sub>O | MolarMass=416.06 | Appearance= | Density= | MeltingPtC=-88 | BoilingPtC=102 | Solubility=Insoluble }} |Section3= {{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt= }} }}
'''FC-75''' is a fluorocarbon derivative of tetrahydrofuran with the chemical formula C<sub>8</sub>F<sub>16</sub>O. It is practically insoluble in water.
It is one of the 3M Fluorinert fluids. It is used as an inert coolant fluid in electronics and other applications, and as a solvent. FC-75 can be synthesized by the same electrochemical fluorination process used to produce PFOA.<ref name=Savu>{{cite encyclopedia |last=Savu |first=P |encyclopedia=Kirk-Othmer Encyclopedia of Chemical Terminology |title=Fluorinated Higher Carboxylic Acids |year=1994 |publisher=John Wiley & Sons, Inc |doi=10.1002/0471238961.0612211519012221.a01|isbn=9780471484943 }}</ref> However, other perfluorinated ether isomers will also result. :H(CH<sub>2</sub>)<sub>7</sub>COCl + HF → H(CH<sub>2</sub>)<sub>7</sub>COF + C<sub>7</sub>H<sub>16</sub> + 2C<sub>8</sub>F<sub>16</sub>O + HCl + H<sub>2</sub>
A similar fluorocarbon-based coolant and solvent is perfluorohexane.
==References== {{reflist}}
Category:Coolants Category:Liquid dielectrics Category:Halogenated solvents Category:Perfluorinated compounds Category:Tetrahydrofurans
{{organohalide-stub}}