{{Chembox | ImageFile = Etpropiolate.png | ImageSize = | ImageAlt = | PIN = Ethyl prop-2-ynoate | OtherNames = Ethyl propynoate<br />Ethyl acetylenecarboxylate |Section1={{Chembox Identifiers | CASNo = 623-47-2 | PubChem = 12182 | ChemSpiderID = 11682 | EINECS = 210-795-8 | Beilstein = 878250 | UNII = W235G5U52S | InChI=1S/C5H6O2/c1-3-5(6)7-4-2/h1H,4H2,2H3 | InChIKey = FMVJYQGSRWVMQV-UHFFFAOYSA-N | SMILES = CCOC(=O)C#C}} |Section2={{Chembox Properties | C=5|H=6|O=2 | MolarMass = | Appearance = colorless liquid | Density = 0.968 g/mL | MeltingPt = | BoilingPtC = 120 | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Ethyl propiolate''' is an [[organic compound]] with the formula HC<sub>2</sub>CO<sub>2</sub>C<sub>2</sub>H<sub>5</sub>. It is the [[Ethyl group|ethyl]] [[ester]] of [[propiolic acid]], the simplest acetylenic [[carboxylic acid]]. It is a colorless liquid that is miscible with organic solvents. The compound is a reagent and building block for the synthesis of other organic compounds, reactions that exploit the electrophilicity of the alkyne group.<ref>{{cite journal|title=α-Unsubstituted γ,δ-Unsaturated Aldehydes by Claisen Rearrangement: 3-phenyl-4-pentenal |author=Dennis E. Vogel |author2=George H. Büchi |journal=Org. Synth.|year=1988|volume=66|page=29|doi=10.15227/orgsyn.066.0029}}</ref>

==References== <references />

[[Category:Alkyne derivatives]] [[Category:Ethyl esters]] [[Category:Carboxylate esters]]

{{ester-stub}}