{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 399922264 | ImageFile=Elephantopin.svg | ImageSize=180px | IUPACName=(1a''R'',8''S'',8a''R'',11a''S'',11b''R'')-1a-Methyl-9-methylene-5,10-dioxo-2,3,5,7,8,8a,9,10,11a,11b-decahydro-1a''H''-3,6-(metheno)furo[2,3-f]oxireno[2,3-d][1]oxacycloundecin-8-yl methacrylate | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=13017-11-3 | ChemSpiderID = 62877965 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 4W3GHK54A3 | PubChem=264743 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 400927 | StdInChI=1S/C19H20O7/c1-8(2)16(20)24-12-6-10-5-11(23-18(10)22)7-19(4)15(26-19)14-13(12)9(3)17(21)25-14/h5,11-15H,1,3,6-7H2,2,4H3/t11-,12-,13+,14-,15?,19?/m0/s1 | StdInChIKey = WIQOUTANBFOBPB-WILRRUMQSA-N | SMILES=O=C1C(C[C@H](OC(C(C)=C)=O)[C@@]23[H])=CC(O1)C[C@]4(C)[C@H](O4)[C@@]3([H])OC(C2=C)=O }} |Section2={{Chembox Properties | C=19 | H=20 | O=7 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Elephantopin''' is a natural chemical compound extracted from the ''Elephantopus elatus'' plant of the genus ''Elephantopus'', family ''Compositae''. It is a sesquiterpene lactone with a germacranolide skeleton, containing two lactone rings and an epoxide functional group.<ref>{{cite journal | doi = 10.1021/ja00967a056 |author1=Kupchan, S. Morris |author2=Aynehchi, Y. |author3=Cassady, John M. |author4=McPhail, A. T. |author5=Sim, G. A. |author6=Shnoes, H. K. |author7=Burlingame, A. L. | title = The isolation and structural elucidation of 2 novel sesquiterpenoid tumor inhibitors from Elephantopus elatus | journal = Journal of the American Chemical Society | year = 1966 | volume = 88 | issue = 15 | pages = 3674–3676}}</ref>
==References== {{reflist}}
Category:Epoxides Category:Sesquiterpene lactones Category:Oxygen heterocycles Category:Heterocyclic compounds with 4 rings
{{Ether-stub}}