{{Short description|Chemical compound}} {{Infobox drug | image = ETFELA.svg | image_class = skin-invert-image | width = 175px | image2 = ETFELA 3D.png | image_class2 = bg-transparent | width2 = 200px
<!-- Clinical data --> | tradename = | routes_of_administration = | class = Serotonin receptor modulator
<!-- Legal status --> | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_US_comment =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 3024529-99-2 | PubChem = 163187757 | ChemSpiderID = | synonyms = TRALA-06; TRALA06; LA-CH<sub>2</sub>CF<sub>3</sub>; ''N''-Ethyl-''N''-(2,2,2-trifluoroethyl)lysergamide
<!-- Chemical data --> | IUPAC_name = (6a''R'',9''R'')-''N''-Ethyl-7-methyl-''N''-(2,2,2-trifluoroethyl)-4,6,6a,7,8,9-hexahydroindolo[4,3-''fg'']quinoline-9-carboxamide | C=20 | H=22 | F=3 | N=3 | O=1 | SMILES = CCN(C(=O)[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)CC(F)(F)F | StdInChI = 1S/C20H22F3N3O/c1-3-26(11-20(21,22)23)19(27)13-7-15-14-5-4-6-16-18(14)12(9-24-16)8-17(15)25(2)10-13/h4-7,9,13,17,24H,3,8,10-11H2,1-2H3/t13-,17-/m1/s1 | StdInChIKey = VAHPXTJQSWECIC-CXAGYDPISA-N }}
'''ETFELA''', also known as '''TRALA-06''' or as '''''N''-ethyl-''N''-(2,2,2-trifluoroethyl)lysergamide''', is an analogue of lysergic acid diethylamide (LSD) first synthesized by Jason C. Parrish as part of the research team led by David E. Nichols. In studies ''in vitro'', it was found to be slightly more potent than LSD itself.<ref>{{cite journal | last1 = Nichols| first1 = David E. | name-list-style = vanc | title = Structure-activity relationships of serotonin 5-HT<sub>2A</sub> agonists| journal = Wiley Interdisciplinary Reviews: Membrane Transport and Signaling| volume = 1| issue = 5| pages = 559–579| year = 2012 | doi = 10.1002/wmts.42 | doi-access = free}}</ref><ref>{{cite book | vauthors = Nichols DE | title = Behavioral Neurobiology of Psychedelic Drugs | s2cid = 4396184 | chapter = Chemistry and Structure-Activity Relationships of Psychedelics | series = Current Topics in Behavioral Neurosciences| volume = 36 | pages = 1–43 | year = 2017 | pmid = 28401524 | doi = 10.1007/7854_2017_475 | isbn = 978-3-662-55878-2 }}</ref>
==Chemistry== ===Analogues=== Analogues of ETFELA include LSD, EcPLA, EiPLA, MiPLA, FLUORETH-LAD (FE-LAD), and FP-LAD, among others.
==See also== * Substituted lysergamide
==References== {{Reflist}}
==External links== * [https://isomerdesign.com/pihkal/explore/5080 ETFELA - Isomer Design]
{{Psychedelics}} {{Serotonin receptor modulators}} {{Ergolines}}
Category:Carboxamides Category:David E. Nichols Category:Psychedelic lysergamides Category:Serotonin receptor modulators Category:Trifluoroethyl compounds