{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one | image = EF-24 Structure.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = | legal_US = | legal_status =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 342808-40-6 | PubChem = 9885748 | ChemSpiderID =8061422 | ChEMBL = 379849 | UNII = O5YT36MST0
<!--Chemical data--> | C=19 | H=15 | F=2 | N=1 | O=1 | SMILES = C\1NC/C(=C\C2=CC=CC=C2F)/C(=O)/C1=C/C3=CC=CC=C3F | StdInChI = 1S/C19H15F2NO/c20-17-7-3-1-5-13(17)9-15-11-22-12-16(19(15)23)10-14-6-2-4-8-18(14)21/h1-10,22H,11-12H2/b15-9+,16-10+ | StdInChIKey = NIVYQYSNRUIFIF-KAVGSWPWSA-N }}
'''EF-24''' is a compound that is a synthetic analogue of curcumin, a bioactive phytochemical from turmeric. Curcumin has antioxidant, antibiotic, anti-inflammatory and anti-cancer properties ''in vitro'' but has low potency and very poor bioavailability when taken orally, resulting in limited efficacy. EF-24 was developed to try to improve upon these properties, and has been found to be around 10 times more potent than curcumin and with much higher systemic bioavailability. It has never been developed for medical use, though research continues to investigate whether it may be useful as an adjuvant treatment for some cancers alongside conventional chemotherapy drugs.<ref>{{cite journal | vauthors = Adams BK, Cai J, Armstrong J, Herold M, Lu YJ, Sun A, Snyder JP, Liotta DC, Jones DP, Shoji M | display-authors = 6 | title = EF24, a novel synthetic curcumin analog, induces apoptosis in cancer cells via a redox-dependent mechanism | journal = Anti-Cancer Drugs | volume = 16 | issue = 3 | pages = 263–75 | date = March 2005 | pmid = 15711178 | doi = 10.1097/00001813-200503000-00005 | s2cid = 33132231 }}</ref><ref>{{cite book | vauthors = Mosley CA, Liotta DC, Snyder JP | title = The Molecular Targets and Therapeutic Uses of Curcumin in Health and Disease | chapter = Highly Active Anticancer Curcumin Analogues | series = Advances in Experimental Medicine and Biology | volume = 595 | pages = 77–103 | date = 2007 | pmid = 17569206 | doi = 10.1007/978-0-387-46401-5_2 | isbn = 978-0-387-46400-8 }}</ref><ref>{{cite journal | vauthors = He Y, Li W, Hu G, Sun H, Kong Q | title = Bioactivities of EF24, a Novel Curcumin Analog: A Review | journal = Frontiers in Oncology | volume = 8 | pages = 614 | date = 2018 | pmid = 30619754 | doi = 10.3389/fonc.2018.00614 | pmc = 6297553 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Li W, He Y, Zhang R, Zheng G, Zhou D | title = The curcumin analog EF24 is a novel senolytic agent | journal = Aging | volume = 11 | issue = 2 | pages = 771–782 | date = January 2019 | pmid = 30694217 | doi = 10.18632/aging.101787 | pmc = 6366974 }}</ref><ref>{{cite journal | vauthors = Bazzaro M, Linder S | title = Dienone Compounds: Targets and Pharmacological Responses | journal = Journal of Medicinal Chemistry | date = November 2020 | volume = 63 | issue = 24 | pages = 15075–15093 | pmid = 33146523 | doi = 10.1021/acs.jmedchem.0c00812 | pmc = 7770821 }}</ref>
== References == {{Reflist}}
{{pharm-stub}}
Category:Anti-inflammatory agents