{{Short description|Natural chemical compound}}

{{Chembox | ImageFile = Dysidazirine.svg | IUPACName = Methyl (2''S'')-3-[(''E'')-pentadec-1-enyl]-2''H''-azirine-2-carboxylate | OtherNames = (''R'')-Dysidazirine; (''R'')-(-)-dysidazirine |Section1={{Chembox Identifiers | CASNo = 113507-74-7 | ChEBI = 185814 | ChEMBL = 572129 | ChemSpiderID = 8742081 | PubChem=10566693 | SMILES = CCCCCCCCCCCCCC=CC(=N1)[C@H]1C(=O)OC | StdInChI=1S/C19H33NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20-17)19(21)22-2/h15-16,18H,3-14H2,1-2H3/b16-15+/t18-/m0/s1 | StdInChIKey=UOLCWKPNWDZCIP-ZPICJPFVSA-N }} |Section2={{Chembox Properties | C=19|H=33|N=1|O=2 }} |Section8={{Chembox Related }} }}

'''Dysidazirine''' is an organic compound with formula C<sub>19</sub>H<sub>33</sub>NO<sub>2</sub>. It was discovered as a natural product in 1988 in the marine sponge ''Dysidea fragilis''.<ref name=ACS>{{cite web |title=Despite my high ring strain, I'm pretty stable. What molecule am I? |url=https://www.acs.org/content/acs/en/molecule-of-the-week/archive/d/r-dysidazirine.html |website=ACS.org |publisher=American Chemical Society |access-date=18 November 2022}}</ref> Chemically, it is a 2''H''-azirine derivative.

Dysidazirine synthesis was reported for the first time in 1995.<ref>{{cite journal | doi = 10.1021/ja00117a050| title = Asymmetric Synthesis of 2H-Azirines: First Enantioselective Synthesis of the Cytotoxic Antibiotic (R)-(-)-Dysidazirine| year = 1995| last1 = Davis| first1 = Franklin A.| last2 = Reddy| first2 = G. Venkat| last3 = Liu| first3 = Hu| journal = Journal of the American Chemical Society| volume = 117| issue = 12| pages = 3651–3652}}</ref>

Dysidazirine kills the yeasts ''Candida albicans'' and ''Sacharamyces cerevisiae'' ''in vitro''.<ref>{{cite journal | doi = 10.1021/ol802065d | title = Synthesis and Antifungal Activity of (−)-(Z)-Dysidazirine | year = 2008 | last1 = Skepper | first1 = Colin K. | last2 = Dalisay | first2 = Doralyn S. | last3 = Molinski | first3 = Tadeusz F. | journal = Organic Letters | volume = 10 | issue = 22 | pages = 5269–5271 | pmid = 18937483 | pmc = 2635126 }}</ref> It also stops HCT-116 human colon cancer cells from growing.<ref name=ACS/>

== References == {{reflist}}

{{ester-stub}}

Category:Azirines Category:Fatty acid esters Category:Methyl esters