{{Short description|Dopaminergic agent}} {{Infobox drug | drug_name = | image = DopAmide.png | image_class = skin-invert-image | width = | caption =

<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = Monoamine precursor; Dopamine receptor agonist | ATC_prefix = | ATC_suffix =

<!-- Legal status --> | legal_status =

<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =

<!-- Identifiers --> | CAS_number = 73148-96-6 | CAS_supplemental = | PubChem = 424633 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 375743 | UNII = | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = <small>L</small>-DopAmide; 3-Hydroxytyrosinamide

<!-- Chemical data --> | IUPAC_name = 2-amino-3-(3,4-dihydroxyphenyl)propanamide | C=9 | H=12 | N=2 | O=3 | SMILES = C1=CC(=C(C=C1CC(C(=O)N)N)O)O | StdInChI = 1S/C9H12N2O3/c10-6(9(11)14)3-5-1-2-7(12)8(13)4-5/h1-2,4,6,12-13H,3,10H2,(H2,11,14) | StdInChIKey = DXOJUCNAHCVBRU-UHFFFAOYSA-N }}

'''DopAmide''', or '''<small>L</small>-DopAmide''', is a synthetic levodopa (<small>L</small>-DOPA) analogue that can serve as a levodopa and dopamine prodrug and is of potential interest in the treatment of Parkinson's disease.<ref name="KangMiaoLiu2021">{{cite journal | vauthors = Kang T, Miao Z, Liu S, Ke B | title = Prodrug Strategies in the CNS Drugs: Small Modification Makes Big Improvements | journal = Current Topics in Medicinal Chemistry | volume = 21 | issue = 24 | pages = 2157–2169 | date = 2021 | pmid = 34315372 | doi = 10.2174/1568026621666210727163827 }}</ref><ref name="UrsoChaudhuriQamar2020">{{cite journal | vauthors = Urso D, Chaudhuri KR, Qamar MA, Jenner P | title = Improving the Delivery of Levodopa in Parkinson's Disease: A Review of Approved and Emerging Therapies | journal = CNS Drugs | volume = 34 | issue = 11 | pages = 1149–1163 | date = November 2020 | pmid = 33146817 | doi = 10.1007/s40263-020-00769-7 }}</ref><ref name="Atlas2016">{{cite journal | vauthors = Atlas D | title = DopAmide: Novel, Water-Soluble, Slow-Release l-dihydroxyphenylalanine (l-DOPA) Precursor Moderates l-DOPA Conversion to Dopamine and Generates a Sustained Level of Dopamine at Dopaminergic Neurons | journal = CNS Neuroscience & Therapeutics | volume = 22 | issue = 6 | pages = 461–467 | date = June 2016 | pmid = 26861609 | pmc = 6492885 | doi = 10.1111/cns.12518 }}</ref> DopAmide has an amide rather than the carboxyl group of <small>L</small>-DOPA,<ref name="UrsoChaudhuriQamar2020" /><ref name="Atlas2016" /> which imparts greater water solubility.<ref name="KangMiaoLiu2021" /><ref name="UrsoChaudhuriQamar2020" /><ref name="Atlas2016" /> The amide is hydrolyzed back to the acid by aminopeptidase enzymes.<ref name="KangMiaoLiu2021" /><ref name="UrsoChaudhuriQamar2020" /><ref name="Atlas2016" />

== See also == * DA-Phen * Foslevodopa * Melevodopa * Etilevodopa * ''O'',''O''′-Diacetyldopamine * ''O'',''O''′-Dipivaloyldopamine * Neurotransmitter prodrug

== References == {{Reflist}}

{{Dopamine receptor modulators}} {{Phenethylamines}}

Category:Antiparkinsonian agents Category:Catecholamines Category:Dopamine agonists Category:Experimental drugs Category:Monoamine precursors Category:Prodrugs Category:Amides

{{Nervous-system-drug-stub}}