{{chembox |Verifiedfields = changed |Watchedfields = changed |verifiedrevid = 399911516 |ImageFile=(isoamyl)2BH dimer.svg |ImageSize=200px |ImageAlt = Skeletal formula of disiamylborane |ImageFile1 = |ImageAlt1 = Ball-and-stick model of the disiamylborane molecule |IUPACName=Bis(1,2-dimethylpropyl)borane |Section1={{Chembox Identifiers |ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |ChemSpiderID = 167251 |InChI = 1/C10H23B/c1-7(2)9(5)11-10(6)8(3)4/h7-11H,1-6H3 |InChIKey = HXJFQNUWPUICNY-UHFFFAOYAY |SMILES1 = B(C(C(C)C)C)C(C)C(C)C |StdInChI_Ref = {{stdinchicite|correct|chemspider}} |StdInChI = 1S/C10H23B/c1-7(2)9(5)11-10(6)8(3)4/h7-11H,1-6H3 |StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |StdInChIKey = HXJFQNUWPUICNY-UHFFFAOYSA-N |CASNo_Ref = {{cascite|correct|??}} |CASNo=1069-54-1 |UNII_Ref = {{fdacite|changed|FDA}} |UNII = 2O6VD8483R |PubChem = 192733 |SMILES=CC(C(C)C)BC(C)C(C)C }} |Section2={{Chembox Properties |Formula=C<sub>10</sub>H<sub>23</sub>B |MolarMass=154.09 g/mol | MeltingPt= 35-40 °C }} }}
'''Disiamylborane''' (bis(1,2-dimethylpropyl)borane) is an organoborane with the formula {{chem2|[((CH3)2CHCH(CH3))2BH]2}} (abbreviation: Sia<sub>2</sub>BH). It is a colorless waxy solid that is used in organic synthesis for hydroboration–oxidation reactions. Like most dialkyl boron hydrides, it has a dimeric structure with bridging hydrides.
==Reactions== Disiamylborane is prepared by hydroboration of trimethylethylene with diborane.<ref name="CV7P0258"/> The reaction stops at the secondary borane due to steric hindrance.
Disiamylborane is relatively selective for terminal alkynes and alkenes vs internal alkynes and alkenes. Like most hydroboration, the addition proceeds in an anti-Markovnikov manner.<ref name="CV7P0258">{{OrgSynth|author=Eric J. Leopold|title=Selective Hydroboration of a 1,3,7-Triene: Homogeraniol|volume= 64|year=1986|page=164|doi=10.15227/orgsyn.064.0164}}</ref> It can be used to convert terminal alkynes, into aldehydes.
The hydroboration process proceeds via an initial dissociation of the dimer.<ref>{{cite journal |doi=10.1021/jo00204a019 |title=Hydroboration kinetics. 11. A reinvestigation of the kinetics of hydroboration of representative alkenes with disiamylborane dimer. Conclusive evidence for the dissociation mechanism in the hydroboration of alkenes with dialkylborane dimers |date=1985 |last1=Chandrasekharan |first1=J. |last2=Brown |first2=Herbert C. |journal=The Journal of Organic Chemistry |volume=50 |issue=4 |pages=518–520 }}</ref>
==Related reagents== *[[9-Borabicyclo(3.3.1)nonane|9-Borabicyclo[3.3.1]nonane]] (9-BBN). * Thexylborane ((1,1,2-trimethylpropyl)borane, ThxBH<sub>2</sub>), a primary borane obtained by hydroboration of tetramethylethylene.
== Naming == The prefix ''disiamyl'' is an abbreviation for "di''-sec-''isoamyl", where ''sec''-isoamyl ("secondary isoamyl") is an archaic name for the 1,2-dimethylpropyl group (amyl being an obsolescent synonym of pentyl).
==References== <references/>
Category:Alkylboranes Category:Reagents for organic chemistry