{{Chembox <!-- Images --> | ImageFile = Dienochlor.svg | ImageSize = 200px | ImageAlt = <!-- Names --> | IUPACName = 1,2,3,4,5-Pentachloro-5-(1,2,3,4,5-pentachlorocyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene | OtherNames = Decachlor, perchlorbis(cyclopenta-2,4-dien-1-yl), pentac <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 2227-17-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 243Z2SVZ40 | PubChem = 16686 | ChemSpiderID = 15823 | EINECS = | SMILES = ClC1=C(Cl)C(Cl)(C2(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl)C(Cl)=C1Cl | StdInChI= 1S/C10Cl10/c11-1-2(12)6(16)9(19,5(1)15)10(20)7(17)3(13)4(14)8(10)18 | StdInChIKey= LWLJUMBEZJHXHV-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C=10|Cl=10 | Appearance = Yellow crystalline solid | Density = 1.923 g/cm<sup>3</sup> | Solubility = Practically insoluble in water | MeltingPtC = 122–123 | BoilingPtC = 250 | VaporPressure = }} | Section3 = {{Chembox Hazards | MainHazards = | GHSPictograms = {{GHS07}} {{GHS09}} | GHSSignalWord = WARNING | HPhrases = {{H-phrases|302|319|400}} | PPhrases = {{P-phrases|264|270|273|280|301+312|305+351+338|330|337|313|391|501}} | FlashPtC = 187.8 | AutoignitionPt = }} }}
'''Dienochlor''' is an organochlorine compound included in the group of cyclic chlorinated hydrocarbons. Its chemical formula is {{chem|C|10|Cl|10}}.<ref>{{cite web|title=Dienochlor|url=http://gestis.itrust.de/nxt/gateway.dll/gestis_de/490367.xml?f=templates$fn=default.htm$3.0|accessdate=1 June 2017}}</ref> Dienochlor is mostly used as a pesticide and ovicide.
==Synthesis== Dienochlor can be obtained by catalytic reduction of hexachlorocyclopentadiene (e.g. with copper or hydrogen).<ref>{{cite web|title=Dienochlor PESTANAL®, analytical standard|url=http://www.sigmaaldrich.com/catalog/product/SIAL/45443?lang=en®ion=RU|website=Sigma Aldrich|publisher=sigmaaldrich.com}}</ref>
center|300px|thumb|Dienochlor synthesis
==Properties== Dienochlor is a combustible yellow solid which is practically insoluble in water. It decomposes when heated above 250 °C. It decomposes rapidly under the influence of sunlight.
==Applications== Dienochlor is used as an acaricide under the trade name Pentac for combating mites (''Tetranychus'', ''Polyphagotarsonemus latus'') on roses, chrysanthemums, and other ornamental plants.<ref>{{cite web|title=PENTAC|url=https://www.nlm.nih.gov/toxnet/index.html|publisher=toxnet.nlm.nih.gov|access-date=1 June 2017}}</ref>
==Regulations== Dienochlor was approved for use in the Western Germany between 1971 and 1990. In the European Union, no plant protection products containing dienochlor are authorized.<ref>{{cite web|title=VERORDNUNG (EG) Nr. 2076/2002 DER KOMMISSION|url=https://eur-lex.europa.eu/legal-content/DE/TXT/PDF/?uri=CELEX:32002R2076|publisher=eur-lex.europa.eu|accessdate=1 June 2017}}</ref>
==References== {{Reflist}}
Category:Perchlorocarbons Category:Acaricides