{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one | image = DU-125530_structure.png | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | routes_of_administration = | class = Serotonin 5-HT<sub>1A</sub> receptor antagonist
<!--Identifiers--> | CAS_number = 161611-99-0 | ATC_prefix = None | PubChem = 9848499 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | ChemSpiderID =
<!--Chemical data--> | C = 23 | H = 26 | Cl = 1 | N = 3 | O = 5 | S = 1 | SMILES = C1CN(CCN1CCCCN2C(=O)C3=CC=CC=C3S2(=O)=O)C4=C5C(=CC(=C4)Cl)OCCO5 | StdInChI = 1S/C23H26ClN3O5S/c24-17-15-19(22-20(16-17)31-13-14-32-22)26-11-9-25(10-12-26)7-3-4-8-27-23(28)18-5-1-2-6-21(18)33(27,29)30/h1-2,5-6,15-16H,3-4,7-14H2 | StdInChIKey = LYXKFNHUJJDTIA-UHFFFAOYSA-N }}
'''DU-125530''' is a drug which acts as a potent and selective 5-HT<sub>1A</sub> receptor antagonist. It has antidepressant effects in animal studies, as well as being used for basic research into the function of the 5-HT<sub>1A</sub> receptor.<ref>{{cite journal | vauthors = Mos J, Van Hest A, Van Drimmelen M, Herremans AH, Olivier B | date = May 1997 | title = The putative 5-HT1A receptor antagonist DU125530 blocks the discriminative stimulus of the 5-HT1A receptor agonist flesinoxan in pigeons | journal = European Journal of Pharmacology | volume = 325 | issue = 2–3 | pages = 145–153 | doi = 10.1016/s0014-2999(97)00131-3 | pmid = 9163561 }}</ref><ref>{{cite journal | vauthors = Rabiner EA, Wilkins MR, Turkheimer F, Gunn RN, Udo de Haes J, de Vries M, Grasby PM | title = 5-Hydroxytryptamine1A receptor occupancy by novel full antagonist 2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzdioxyn-5-yl)-1-piperazinyl]butyl]-1,2-benzisothiazol-3-(2H)-one-1,1-dioxide: a[11C][O-methyl-3H]-N-(2-(4-(2-methoxyphenyl)-1-piperazinyl)ethyl)-N-(2-pyridinyl)cyclohexanecarboxamide trihydrochloride (WAY-100635) positron emission tomography study in humans | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 301 | issue = 3 | pages = 1144–1150 | date = June 2002 | pmid = 12023549 | doi = 10.1124/jpet.301.3.1144 }}</ref><ref>{{cite journal | vauthors = Scorza MC, Lladó-Pelfort L, Oller S, Cortés R, Puigdemont D, Portella MJ, Pérez-Egea R, Alvarez E, Celada P, Pérez V, Artigas F | title = Preclinical and clinical characterization of the selective 5-HT(1A) receptor antagonist DU-125530 for antidepressant treatment | journal = British Journal of Pharmacology | volume = 167 | issue = 5 | pages = 1021–1034 | date = November 2012 | pmid = 22050051 | doi = 10.1111/j.1476-5381.2011.01770.x | pmc = 3492984 }}</ref>
== See also == * GSK-958108 * SDZ-216-525 * WAY-100635
== References == {{Reflist}}
{{Serotonergics}} {{Piperazines}}
Category:5-HT1A antagonists Category:Piperazines Category:Benzothiazoles Category:Sulfones Category:Benzodioxins
{{nervous-system-drug-stub}}