{{chembox | Watchedfields = changed | verifiedrevid = 441743867 | Name = | ImageFile = DPPH.svg | ImageSize = 220 | ImageAlt = Skeletal formula of DPPH | ImageFile1 = Dpph sample.jpg | ImageSize1 = 220 | ImageAlt1 = sample | PIN = 2,2-Diphenyl-1-(2,4,6-trinitrophenyl)hydrazin-1-yl | OtherNames = 2,2-Diphenyl-1-picrylhydrazyl<br/>1,1-Diphenyl-2-picrylhydrazyl radical<br/>2,2-Diphenyl-1-(2,4,6-trinitrophenyl)hydrazyl<br/>Diphenylpicrylhydrazyl | Section1 = {{Chembox Identifiers | Abbreviations = DPPH | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2016757 | InChIKey = WCBPJVKVIMMEQC-UHFFFAOYAG | InChI1 = 1/C18H12N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H | InChIKey1 = HHEAADYXPMHMCT-UHFFFAOYAG | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H12N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = HHEAADYXPMHMCT-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 1898-66-4 | UNII_Ref = {{fdacite|Correct|FDA}} | UNII = DFD3H4VGDH | EINECS = | PubChem = 74358 | SMILES = c1ccc(cc1)N(c2ccccc2)[N]c3c(cc(cc3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] | InChI = 1/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H }} | Section2 = {{Chembox Properties | C = 18 | H = 12 | N = 5 | O = 6 | Appearance = Black to green powder, purple in solution | Density = 1.4 g/cm<sup>3</sup> | MeltingPtC = 135 | MeltingPt_notes = (decomposes) | BoilingPtC = | BoilingPt_notes = | Solubility = insoluble | Solubility1 = 10 mg/mL | Solvent1 = methanol | Solvent = alcohol, acetone | pKa = | pKb =}} | Section3 = | Section4 = | Section5 = | Section6 = | Section7 = {{Chembox Hazards | MainHazards = | ExternalSDS = [http://datasheets.scbt.com/sc-202591.pdf MSDS] | NFPA-H = 0 | NFPA-F = 1 | NFPA-R = 0 | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL =}} }}

'''DPPH''' ('''2,2-diphenyl-1-picrylhydrazyl''') is an organic chemical compound. It is a dark-colored crystalline powder composed of stable free radical molecules. DPPH has two major applications, both in laboratory research: one is a monitor of chemical reactions involving radicals, most notably it is a common antioxidant assay,<ref>{{cite journal|title=DPPH antioxidant assay revisited |first1=Om P. |last1=Sharma |first2=Tej K. |last2=Bhat |journal=Journal of Food Chemistry |volume=113 |issue=4 |date=15 April 2009 |pages=1202–1205 |doi=10.1016/j.foodchem.2008.08.008}}</ref> and another is a standard of the position and intensity of electron paramagnetic resonance signals.

== Properties and applications == DPPH has several crystalline forms which differ by the lattice symmetry and melting point. The commercial powder is a mixture of phases which melts at ~130&nbsp;°C. DPPH-I (m.p.&nbsp;106&nbsp;°C) is orthorhombic, DPPH-II (m.p.&nbsp;137&nbsp;°C) is amorphous and DPPH-III (m.p.&nbsp;128–129&nbsp;°C) is triclinic.<ref>{{cite journal|doi=10.1107/S0567740876007632|title=The crystal structure of a 2,2-diphenyl-1-picrylhydrazyl (DPPH) modification|year=1976|last1=Kiers|first1=C. T.|last2=De Boer|first2=J. L.|last3=Olthof|first3=R.|last4=Spek|first4=A. L.|journal=Acta Crystallographica Section B|volume=32|pages=2297|issue=8}}</ref>

DPPH is a well-known radical and a trap ("scavenger") for other radicals. Therefore, rate reduction of a chemical reaction upon addition of DPPH is used as an indicator of the radical nature of that reaction. Because of a strong absorption band centered at about 520&nbsp;nm, the DPPH radical has a deep violet color in solution, and it becomes colorless or pale yellow when neutralized. This property allows visual monitoring of the reaction, and the number of initial radicals can be counted from the change in the optical absorption at 520&nbsp;nm or in the EPR signal of the DPPH.<ref>{{cite book|url=https://books.google.com/books?id=OSAaRwBXGuEC&pg=PA152|page=152|title=Polymer science dictionary|first=Mark S. M.|last=Alger|publisher=Springer|year=1997|isbn=0-412-60870-7}}</ref>

:500px

Because DPPH is an efficient radical trap, it is also a strong inhibitor of radical-mediated polymerization.<ref name="ca2008">{{cite book|last=Cowie|first=J. M. G.|last2=Arrighi|first2=Valeria|title=Polymers: Chemistry and Physics of Modern Materials|publisher=CRC Press|location=Scotland|year=2008|edition=3rd|isbn=978-0-8493-9813-1}}</ref> :thumb|500px|left|Inhibition of polymer chain, R, by DPPH. {{clear-left}} As a stable and well-characterized solid radical source, DPPH is the traditional and perhaps the most popular standard of the position (g-marker) and intensity of electron paramagnetic resonance (EPR) signals – the number of radicals for a freshly prepared sample can be determined by weighing and the EPR splitting factor for DPPH is calibrated at ''g''&nbsp;= 2.0036. DPPH signal is convenient by that it is normally concentrated in a single line, whose intensity increases linearly with the square root of microwave power in the wider power range. The dilute nature of the DPPH radicals (one unpaired spin per 41 atoms) results in a relatively small linewidth (1.5–4.7&nbsp;G). The linewidth may however increase if solvent molecules remain in the crystal and if measurements are performed with a high-frequency EPR setup (~200&nbsp;GHz), where the slight ''g''-anisotropy of DPPH becomes detectable.<ref>{{cite book|url=https://books.google.com/books?id=ywjuZo9UackC&pg=PA178|page=178|title=Electron Paramagnetic Resonance|author=M.J. Davies|publisher=Royal Society of Chemistry|year=2000|isbn=0-85404-310-1}}</ref><ref>{{cite book|url=https://books.google.com/books?id=P-4PIoi7Z7IC&pg=PA443|page=443|title=Electron spin resonance: a comprehensive treatise on experimental techniques|author=Charles P. Poole|publisher=Courier Dover Publications|year=1996|isbn=0-486-69444-5}}</ref>

Whereas DPPH is normally a paramagnetic solid, it transforms into an antiferromagnetic state upon cooling to very low temperatures of the order 0.3 K. This phenomenon was first reported by Alexander Prokhorov in 1963.<ref>A. M. Prokhorov and V.B. Fedorov, Soviet Phys. JETP 16 (1963) 1489.</ref><ref>{{cite journal|page=3110|journal=Bulletin of the Chemical Society of Japan|volume=54|issue=10|year=1981|title=Magnetic Interaction in Solvent-free DPPH and DPPH–Solvent Complexes|first=Teruaki|last=Fujito|doi=10.1246/bcsj.54.3110|doi-access=free}}</ref><ref>{{cite book|chapter-url=https://books.google.com/books?id=uywFzcv3Tv8C&pg=PA118|page=118|title=Nobel Lectures in Physics, 1963–1970|first=Stig|last=Lundqvist|publisher=World Scientific|year=1998|isbn=981-02-3404-X|chapter=A. M. Prokhorov}}</ref><ref>[http://nobelprize.org/nobel_prizes/physics/laureates/1964/prokhorov-bio.html Aleksandr M. Prokhorov, The Nobel Prize in Physics 1964]</ref>

==References== {{reflist|30em}}

Category:Free radicals