{{short description|Chemical compound}} {{Chembox <!-- Images --> | ImageFile = File:DPEphos.svg | ImageSize = 170 | ImageAlt = DPEphos structure <!-- Names --> | PIN = [Oxydi(2,1-phenylene)]bis(diphenylphosphane) | OtherNames = DPEphos, Bis[(2-diphenylphosphino)phenyl] ether <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 166330-10-5 | CASNo_Ref = {{Cascite|correct|CAS}} | ChemSpiderID = 3492440 | EINECS = 678-206-0 | PubChem = 4285986 | StdInChI=1S/C36H28OP2/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H | StdInChIKey = RYXZOQOZERSHHQ-UHFFFAOYSA-N | SMILES = C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3OC4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6 }} | Section2 = {{Chembox Properties |C=36|P=2|H=28|O=1 | Appearance = white powder | Density = | MeltingPtC = 175-176 | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/4285986#section=Safety-and-Hazards] | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|302|315|319|335|413}} | PPhrases = {{P-phrases|261|264|264+265|270|271|273|280|301+317|302+352|304+340|305+351+338|319|321|330|332+317|337+317|362+364|403+233|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Bis[(2-diphenylphosphino)phenyl] ether''', also known as '''DPEphos''', is a wide bite angle diphosphine ligand used in inorganic and organometallic chemistry. The name DPEphos is derived from diphenyl ether (DPE) which makes up the ligand's backbone. It is similar to Xantphos, another diphosphine ligand, but is more flexible and has a smaller bite angle (104 vs 108°).<ref name="vanLeeuwen09">{{cite journal |last1=Birkholz (née Gensow) |first1=Mandy-Nicole |last2=Freixa |first2=Zoraida |last3=van Leeuwen |first3=Piet W. N. M. |title=Bite angle effects of diphosphines in C–C and C–X bond forming cross coupling reactions |journal=Chemical Society Reviews |date=2009 |volume=38 |issue=4 |pages=1099–118 |doi=10.1039/B806211K|pmid=19421583 }}</ref> It is synthesized from chlorodiphenylphosphine and DPE.<ref name="VanLeeuwen95">{{cite journal |last1=Kranenburg |first1=Mirko |last2=van der Burgt |first2=Yuri E. M. |last3=Kamer |first3=Paul C. J. |last4=van Leeuwen |first4=Piet W. N. M. |last5=Goubitz |first5=Kees |last6=Fraanje |first6=Jan |title=New Diphosphine Ligands Based on Heterocyclic Aromatics Inducing Very High Regioselectivity in Rhodium-Catalyzed Hydroformylation: Effect of the Bite Angle |journal=Organometallics |date=June 1995 |volume=14 |issue=6 |pages=3081–3089 |doi=10.1021/om00006a057|url=https://pure.uva.nl/ws/files/2969936/882_9954y.pdf }}</ref>
==References== {{reflist}}
Category:Diphosphines Category:Phenyl compounds Category:Tridentate ligands