{{Short description|Substituted amphetamine designer drug}} {{drugbox | drug_name = | image = DOPF structure.svg | image_class = skin-invert-image | width = 250px | routes_of_administration = Unknown<ref name="TrachselLehmannEnzensperger2013" /> | duration_of_action = Unknown<ref name="TrachselLehmannEnzensperger2013" /> | legal_UK = | legal_DE = | C = 14 | H = 22 | F = 1 | N = 1 | O = 2 | IUPAC_name = 2-[4-(3-fluoropropyl)-2,5-dimethoxyphenyl]ethanamine | CAS_number = | ChemSpiderID = 129558527 | PubChem = 163192484 | synonyms = DOPF; 2,5-Dimethoxy-4-(3-fluoropropyl)amphetamine; 4-(3-Fluoropropyl)-2,5-dimethoxyamphetamine | SMILES = COc1cc(CCCF)c(cc1CC(C)N)OC | StdInChI=1S/C14H22FNO2/c1-10(16)7-12-9-13(17-2)11(5-4-6-15)8-14(12)18-3/h8-10H,4-7,16H2,1-3H3 | StdInChIKey = UIHSFMYQJAKMHD-UHFFFAOYSA-N }}

'''DOPF''', also known as '''2,5-dimethoxy-4-(3-fluoropropyl)amphetamine''', is a designer drug from the amphetamine and DOx families.<ref name="TrachselLehmannEnzensperger2013" /> It was first synthesised by Alexander Shulgin and David Nichols in 1989 but was never published at the time, and was finally disclosed in Daniel Trachsel's review of the field in 2013.<ref name="TrachselLehmannEnzensperger2013" /> It has a binding affinity (K<sub>i</sub>) of 9&nbsp;nM at the serotonin receptor 5-HT<sub>2A</sub> but is not known to have been tested in humans.<ref name="TrachselLehmannEnzensperger2013">{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine Von der Struktur zur Funktion | trans-title = Phenethylamine From structure to function | language = German | page = 778-780 | publisher = Nachtschatten Verlag AG | date = 2013 | isbn = 978-3-03788-700-4 }}</ref> DOPF is a controlled substance in Canada under phenethylamine blanket-ban language.<ref name="CDSA">{{cite web | title=Controlled Drugs and Substances Act | website=Department of Justice Canada | url=https://laws-lois.justice.gc.ca/eng/acts/c-38.8/FullText.html | access-date=19 January 2026}}</ref>

== See also == * DOx (psychedelics) * DOBU * DOEF * DOPR * DOTFM * 2C-TFE * 2C-T-21 * 2C-T-28

== References == {{Reflist}}

==External links== * [https://isomerdesign.com/pihkal/explore/10323 DOPF - Isomer Design]

{{Psychedelics}} {{Serotonin receptor modulators}} {{Phenethylamines}}

Category:Daniel Trachsel Category:Designer drugs Category:DOx (psychedelics) Category:Methoxy compounds Category:Organofluorides Category:Psychedelic phenethylamines Category:Serotonin receptor modulators

{{Hallucinogen-stub}}