{{Chembox <!-- Images --> | ImageFile = Cryptostictic acid.svg | ImageSize = 200px | ImageAlt = <!-- Names --> | IUPACName = 13,17-Dihydroxy-4-(hydroxymethyl)-5-methoxy-7,12-dimethyl-2,10,16-trioxatetracyclo[9.7.0.0<sup>3,8</sup>.0<sup>14,18</sup>]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione | OtherNames = <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = | ChemSpiderID = 34964700 | PubChem = 14991098 | SMILES = CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3C)O)C(=O)OC4O)CO)OC | InChI = 1S/C19H16O9/c1-6-4-9(25-3)8(5-20)15-10(6)17(22)27-14-7(2)13(21)11-12(16(14)26-15)19(24)28-18(11)23/h4,19-21,24H,5H2,1-3H3 | InChIKey = RXSMOJAAXFOGKM-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C = 19 | H = 16 | O = 9 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Cryptostictic acid''' is a chemical compound of the [[depsidone]] class. It has the molecular formula {{chem2|C19H16O9}} and is a [[secondary metabolite]] of various [[lichen]]s. It was first reported in 1980 as a constituent of ''[[Lobaria oregana]]''.<ref>{{cite journal | doi = 10.1016/S0031-9422(00)81987-1 | title = New depsidones from Lobaria oregana | date = 1980 | last1 = Shimada (Née Miyoshi) | first1 = Sachiko | last2 = Saitoh | first2 = Tamotsu | last3 = Sankawa | first3 = Ushio | last4 = Shibata | first4 = Shoji | journal = Phytochemistry | volume = 19 | issue = 2 | pages = 328–330 | bibcode = 1980PChem..19..328S }}</ref> It has since been identified in lichens in the genera ''[[Ramalina]]'',<ref>{{cite journal | doi = 10.1016/j.phytochem.2013.02.002 | title = Comparative metabolite profiling and chemical study of Ramalina siliquosa complex using LC–ESI-MS/MS approach | date = 2013 | last1 = Parrot | first1 = Delphine | last2 = Jan | first2 = Saleem | last3 = Baert | first3 = Nicolas | last4 = Guyot | first4 = Sylvain | last5 = Tomasi | first5 = Sophie | journal = Phytochemistry | volume = 89 | pages = 114–124 | pmid = 23489575 | bibcode = 2013PChem..89..114P }}</ref> ''[[Oxneriaria]]'',<ref>{{cite journal | doi = 10.1007/s00606-022-01836-w | title = Two new species of the genus Oxneriaria (Lichenized Ascomycota: Megasporaceae) from Pakistan | date = 2023 | last1 = Zulfiqar | first1 = Rizwana | last2 = Asghar | first2 = Hafiza Simab | last3 = Habib | first3 = Kamran | last4 = Khalid | first4 = Abdul Nasir | journal = Plant Systematics and Evolution | volume = 309 | issue = 1 | page = 2 | bibcode = 2023PSyEv.309....2Z }}</ref> and ''[[Usnea]]'',<ref>{{cite journal | doi = 10.1021/np070145k | title = Stictic Acid Derivatives from the Lichen ''Usnea '' ''articulata'' and Their Antioxidant Activities | date = 2007 | last1 = Lohézic-Le Dévéhat | first1 = Françoise | last2 = Tomasi | first2 = Sophie | last3 = Elix | first3 = John A. | last4 = Bernard | first4 = Aurélie | last5 = Rouaud | first5 = Isabelle | last6 = Uriac | first6 = Philippe | last7 = Boustie | first7 = Joël | journal = Journal of Natural Products | volume = 70 | issue = 7 | pages = 1218–1220 }}</ref> among others.
==References== {{reflist}}
[[Category:Carboxylic acids]] [[Category:Lichen products]] [[Category:Heterocyclic compounds with 4 rings]] [[Category:Benzodioxepines]] [[Category:Methoxy compounds]] [[Category:Lactones]] [[Category:Triols]] [[Category:Oxygen heterocycles]]