{{Short description|Opioid analgesic designer drug}} {{Drugbox | IUPAC_name = (2E)-N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-butenamide | image = Crotonylfentanyl Structure.svg | image_class = skin-invert-image | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 760930-59-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = R0XLG8CO63 | ATC_prefix = | ATC_suffix = | PubChem = 10472960 | KEGG = C22759 | DrugBank = | ChemSpiderID = 8648371 | C=23 | H=28 | N=2 | O=1 | molecular_weight = | smiles = O=C(/C=C/C)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | StdInChI2 = 1/C23H28N2O/c1-2-9-23(26)25(21-12-7-4-8-13-21)22-15-18-24(19-16-22)17-14-20-10-5-3-6-11-20/h2-13,22H,14-19H2,1H3/b9-2+ | StdInChIKey2 = VDYXGPCGBKLRDA-XNWCZRBMBF | StdInChI = 1S/C23H28N2O/c1-2-9-23(26)25(21-12-7-4-8-13-21)22-15-18-24(19-16-22)17-14-20-10-5-3-6-11-20/h2-13,22H,14-19H2,1H3/b9-2+ | StdInChIKey = VDYXGPCGBKLRDA-XNWCZRBMSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category= | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_BR = F1 | legal_CA = Schedule I | legal_DE = Anlage II | legal_UK = Class A | legal_UN = N I | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = }}
'''Crotonylfentanyl''' is an opioid analgesic that is an analog of fentanyl and structural isomer of cyclopropylfentanyl<ref>{{cite journal | vauthors = Mallette JR, Casale JF, Hays PA | title = Characterization and differentiation of cyclopropylfentanyl from E-crotonylfentanyl, Z-crotonylfentanyl, and 3-butenylfentanyl | journal = Science & Justice | volume = 59 | issue = 1 | pages = 67–74 | date = January 2019 | pmid = 30654970 | doi = 10.1016/j.scijus.2018.07.005 | s2cid = 58646707 }}</ref> and has been sold online as a designer drug.<ref>{{cite journal | vauthors = Varshneya NB, Walentiny DM, Moisa LT, Walker TD, Akinfiresoye LR, Beardsley PM | title = Opioid-like antinociceptive and locomotor effects of emerging fentanyl-related substances | journal = Neuropharmacology | volume = 151 | pages = 171–179 | date = June 2019 | pmid = 30904478 | pmc = 8992608 | doi = 10.1016/j.neuropharm.2019.03.023 | s2cid = 84182661 }}</ref><ref>{{cite journal | vauthors = Palaty J, Konforte D, Karakosta T, Wong E, Stefan C | title = Rapid identification of cyclopropyl fentanyl/crotonyl fentanyl in clinical urine specimens: A case study of clinical laboratory collaboration in Canada | journal = Clinical Biochemistry | volume = 53 | pages = 164–167 | date = March 2018 | pmid = 29395089 | doi = 10.1016/j.clinbiochem.2018.01.013 }}</ref> In December 2019, the UNODC announced scheduling recommendations placing crotonylfentanyl into Schedule I.<ref>{{cite web|url=https://www.unodc.org/LSS/Announcement/Details/021820a0-8746-42a4-9ee3-47ce50b30ca3|date = December 2019 | publisher = WHO | title = World Health Organization recommends 12 NPS for scheduling}}</ref>
== See also == * Valerylfentanyl * Acrylfentanyl
== References == {{Reflist}}
{{Opioidergics}}
Category:Anilides Category:Designer drugs Category:Mu-opioid receptor agonists Category:Piperidines Category:Synthetic opioids