{{Distinguish|Constipatic acid}} {{Chembox <!-- Images --> | ImageFile = Constictic acid.svg | ImageSize = 200px | ImageAlt = <!-- Names --> | IUPACName = | OtherNames = <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 30287-05-9 | CASNo_Ref = {{Cascite|correct|CAS}} | ChemSpiderID = 95797318 | PubChem = 71436827 | SMILES = CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3CO)O)C(=O)OC4O)C=O)OC | InChI = 1S/C19H14O10/c1-6-3-9(26-2)7(4-20)14-10(6)17(23)28-15-8(5-21)13(22)11-12(16(15)27-14)19(25)29-18(11)24/h3-4,19,21-22,25H,5H2,1-2H3 | InChIKey = FYPCEUKJORJHDL-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C=19 | H=14 | O=10 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Constictic acid''' is a chemical compound of the [[depsidone]] class. It was first isolated in 1968 from [[lichen]] of the genus ''[[Usnea]]''.<ref>{{cite journal | doi = 10.1248/cpb.18.2364 | title = The Structure of Constictic Acid | year = 1970 | last1 = Yosioka | first1 = Itiro | last2 = Morita | first2 = Yutaka | last3 = Ebihara | first3 = Kikuko | journal = Chemical and Pharmaceutical Bulletin | volume = 18 | issue = 11 | pages = 2364–2366 | doi-access = free }}</ref> It has since been found in many other lichen genera including ''[[Menegazzia]]'',<ref name="McCarthy & Elix 2018">{{cite journal |last1=McCarthy |first1=P.M. |last2=Elix |first2=John A. |year=2018 |title=New species and records of lichens from the Cook Islands |journal=Australian Lichenology |volume=82 |page=1 |url=https://www.anbg.gov.au/abrs/lichenlist/AL82.pdf}}</ref> ''[[Crespoa]]'',<ref name="Hawksworth 2011">{{cite journal |last1=Hawksworth |first1=David L. |year=2011 |title=''Parmotrema'' subgen. ''Crespoa'' subgen. nov. for the ''Canoparmelia crozalsiana'' clade |journal=Lichenologist |volume=43 |issue=6 |pages=647–648 |doi=10.1017/S0024282911000399|s2cid=86356671 }}</ref> and ''[[Xanthoparmelia]]''.<ref name="Blanco et al. 2005">{{cite journal |last1=Blanco |first1=Oscar |last2=Crespo |first2=Ana|last3=Elix |first3=John A. |title=Two new species of ''Xanthoparmelia'' (Ascomycota: Parmeliaceae) from Spain |journal=Lichenologist |volume=37 |issue=2 |year=2005 |pages=97–100 |doi=10.1017/S0024282905014829|s2cid=86778304 }}</ref>
==References== {{reflist}}
[[Category:Lactones]] [[Category:Benzaldehydes]] [[Category:Heterocyclic compounds with 4 rings]] [[Category:Hydroxyarenes]] [[Category:Methoxy compounds]] [[Category:Benzodioxepines]] [[Category:Lichen products]] [[Category:Oxygen heterocycles]]
{{Ether-stub}}