{{chembox | ImageFile = Confusarin.svg | ImageCaption = Chemical structure of confusarin | PIN = 1,5,6-Trimethoxyphenanthrene-2,7-diol | OtherNames = 2,7-dihydroxy-3,4,8-trimethoxyphenanthrene |Section1={{Chembox Identifiers | CASNo_Ref = {{Cascite|changed|CAS}} | CASNo = 108909-02-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = CRH455ZW4X | ChEMBL = 3634642 | ChemSpiderID = 10155793 | InChI = 1/C17H16O5/c1-20-15-11-5-4-9-8-13(19)16(21-2)17(22-3)14(9)10(11)6-7-12(15)18/h4-8,18-19H,1-3H3 | InChIKey = JHNVCKNCEVZGGC-UHFFFAOYAW | StdInChI = 1S/C17H16O5/c1-20-15-11-5-4-9-8-13(19)16(21-2)17(22-3)14(9)10(11)6-7-12(15)18/h4-8,18-19H,1-3H3 | StdInChIKey = JHNVCKNCEVZGGC-UHFFFAOYSA-N | PubChem = 11983285 | SMILES = COc3c2c(ccc1c(OC)c(O)ccc12)cc(O)c3OC }} |Section2={{Chembox Properties | C = 17 | H = 16 | O = 5 | Appearance = | Density = | MeltingPtC = | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = | AutoignitionPt = }} }}
'''Confusarin''' is a phenanthrenoid found in the orchids ''Eria confusa''<ref>{{cite journal | doi = 10.1016/S0031-9422(00)82363-8 | title = Confusarin and confusaridin two phenanthrene derivatives of the orchid Eria Confusa | date = 1987 | last1 = Majumder | first1 = P.L. | last2 = Kar | first2 = Amita | journal = Phytochemistry | volume = 26 | issue = 4 | pages = 1127–1129 | bibcode = 1987PChem..26.1127M }}</ref> and ''Bulbophyllum reptans''.<ref>{{cite journal | doi = 10.1016/S0031-9422(98)00609-8 | title = Dimeric phenanthrenes from the orchid Bulbophyllum reptans | date = 1999 | last1 = Majumder | first1 = P.L | last2 = Pal | first2 = S. | last3 = Majumder | first3 = S. | journal = Phytochemistry | volume = 50 | issue = 5 | pages = 891–897 | bibcode = 1999PChem..50..891M }}</ref> It can also be synthesized.<ref>{{cite journal | doi = 10.1016/j.tet.2007.09.052 | title = Total synthesis of two natural phenanthrenes: Confusarin and a regioisomer | date = 2007 | last1 = Radix | first1 = Sylvie | last2 = Barret | first2 = Roland | journal = Tetrahedron | volume = 63 | issue = 50 | pages = 12379–12387 }}</ref>
== References == {{reflist}}
== External links == * [https://web.archive.org/web/20150711030832/http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00015258 Confusarin at kanaya.naist.jp/knapsack_jsp]
{{phenanthrenes}}
Category:Phenanthrenoids Category:Orchids Category:Methoxy compounds
{{aromatic-stub}}