{{chembox | ImageFile = Coeloginin.svg | ImageCaption = Chemical structure of coeloginin | PIN = 2,6-Dihydroxy-7,8-dimethoxy-9,10-dihydro-5''H''-phenanthro[4,5-''bcd'']pyran-5-one | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 82358-34-7 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = AT7CHG83PJ | ChEBI_Ref = | ChEBI = | KEGG_Ref = | KEGG = | PubChem = 14427337 | SMILES = c4c1CCc3c2c1c(cc4O)oc(=O)c2c(O)c(OC)c3OC | EINECS = | ChemSpiderID = 58794085 | InChI = 1/C17H14O6/c1-21-15-9-4-3-7-5-8(18)6-10-11(7)12(9)13(17(20)23-10)14(19)16(15)22-2/h5-6,18-19H,3-4H2,1-2H3 | InChIKey = PHSQBKCKZRQIDM-UHFFFAOYAJ | StdInChI = 1S/C17H14O6/c1-21-15-9-4-3-7-5-8(18)6-10-11(7)12(9)13(17(20)23-10)14(19)16(15)22-2/h5-6,18-19H,3-4H2,1-2H3 | StdInChIKey = PHSQBKCKZRQIDM-UHFFFAOYSA-N | RTECS = | MeSHName = }} |Section2={{Chembox Properties | C=17 | H=14 | O=6 | Appearance = | Density = | MeltingPtC = | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = | AutoignitionPt = }} }}
'''Coeloginin''' is a phenanthrenoid found in the high altitude Himalayan orchid ''Coelogyne cristata''. This molecule has a phenanthro[4,5-''bcd'']pyrone structure.<ref>{{cite journal | doi = 10.1039/P19820001131| title = Coelogin and coeloginin: Two novel 9,10-dihydrophenanthrene derivatives from the orchid Coelogyne cristata| journal = Journal of the Chemical Society, Perkin Transactions 1| pages = 1131| year = 1982| last1 = Majumder| first1 = Priyalal| last2 = Bandyopadhyay| first2 = Debabrata| last3 = Joardar| first3 = Subhendu}}</ref><ref>{{cite journal | pmid = 11576602| year = 2001| last1 = Majumder| first1 = P. L.| title = Phenanthrene derivatives from the orchid Coelogyne cristata| journal = Phytochemistry| volume = 58| issue = 4| pages = 581–6| last2 = Sen| first2 = S.| last3 = Majumder| first3 = S.| doi = 10.1016/S0031-9422(01)00287-4}}</ref>
== References == {{reflist}}
{{phenanthrenes}}
Category:Phenanthrenoids Category:Coelogyne
{{aromatic-stub}}