{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = (((4,5α-Epoxy-3-methoxy-17-methylmorphinan-6-ylidene)amino)oxy)acetic acid | image = Codoxime.svg | image_class = skin-invert-image | width = 220
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_BR = A1 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}</ref> | legal_CA = Schedule I | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = | legal_UN = N I | legal_DE = Anlage I | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 7125-76-0 | ATC_prefix = none | ATC_suffix = | PubChem = 9570253 | DrugBank = | ChEMBL = 2107300 | ChemSpiderID = 7844721 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = JT5I2F57F7 | KEGG = D03581
<!--Chemical data--> | C=20 | H=24 | N=2 | O=5 | smiles = O=C(O)CO\N=C4\[C@@H]5Oc1c2c(ccc1OC)C[C@H]3N(CC[C@]25[C@H]3CC4)C | synonyms = Codoxime }}
'''Codoxime''' ('''Codossima''') is an opiate analogue that is a derivative of hydrocodone, where the 6-ketone group has been replaced by carboxymethyloxime. It has primarily antitussive effects<ref>{{cite patent |country= US |number= 3153042 |status= granted |title= Morphinone and Codeinone Derivatives |pubdate= |gdate= 13 October 1964 |fdate= |pridate= |inventor = Jack Fishman |assign1= Mozes Juda Lowenstein }}</ref> and was found to have moderate potential to cause dependence in animal studies.<ref name="pmid6021586">{{cite journal | vauthors = Jasinski DR, Martin WR | title = Assessment of the dependence-producing properties of dihydrocodeinone and codoxime | journal = Clinical Pharmacology and Therapeutics | volume = 8 | issue = 2 | pages = 266–70 | date = 1967 | pmid = 6021586 | doi = 10.1002/cpt196782266 | s2cid = 36504901 }}</ref>
==References== {{Reflist|2}}
{{Opioidergics}}
Category:Antitussives Category:4,5-Epoxymorphinans Category:Catechol ethers Category:Mu-opioid receptor agonists Category:Semisynthetic opioids
{{analgesic-stub}}