{{Chembox | ImageFile = Cocoamide monoethanolamine.svg | ImageSize = 250px | ImageCaption = Cocoamide MEA | IUPACName = N-(2-hydroxyethyl)dodecanamide | OtherNames = Cocamide monoethanolamine; Monoethanolamine coconut acid amide; Coco monoethanolamide; Coconut fatty acid monoethanolamide; Cocoyl monoethanolamine; ''N''-(2-Hydroxyethyl) coco fatty acid amide; Coconut oil fatty acid ethanolamide |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 68140-00-1 | PubChem = 8899 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = C80684146D | ChEBI = 85263 | ChEMBL = 246914 | EC_number = 268-770-2 | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17) | InChIKey = QZXSMBBFBXPQHI-UHFFFAOYSA-N | SMILES = CCCCCCCCCCCC(=O)NCCO | ChemSpiderID = none }} |Section2={{Chembox Properties | Formula = CH<sub>3</sub>(CH<sub>2</sub>)<sub>n</sub>CONHCH<sub>2</sub>CH<sub>2</sub>OH | MolarMass = | Appearance = | Density = 1.08-1.09 g/cm<sup>3</sup><ref name=chemicalland21>[http://chemicalland21.com/specialtychem/NH/COCAMIDE%20MEA.htm Cocamide MEA], chemicalland21.com</ref> | MeltingPtC = 60 to 63 | MeltingPt_ref = {{cn|date=November 2014}} | BoilingPt = > | BoilingPtC = 200 | BoilingPt_ref = <ref name=chemicalland21/> | Solubility = }} |Section3={{Chembox Hazards | LD50 = > 3000 mg/kg (oral, rat)<ref name=chemicalland21/> | MainHazards = | FlashPt = | AutoignitionPt = | GHSPictograms = {{GHS05}}{{GHS07}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|315|318}} | PPhrases = {{P-phrases|264|270|273|280|301+312|302+352|305+351+338|310|321|330|332+313|362|391|501}} }} }}
'''Cocamide MEA''', or '''cocamide monoethanolamine''', is a solid, off-white to tan compound, often sold in flaked form. The solid melts to yield a pale yellow viscous clear liquid. It is a mixture of fatty acid amides which is produced from the fatty acids in coconut oil when reacted with ethanolamine.
==Uses== Cocamide MEA and other cocamide ethanolamines such as cocamide DEA are used as foaming agents and nonionic surfactants in shampoos and bath products, and as emulsifying agents in cosmetics.
==See also== * Cocamide
==References== {{reflist}}
Category:Non-ionic surfactants Category:Cosmetics chemicals Category:Fatty acid amides