{{distinguish|cephalin}} {{Chembox | verifiedrevid = 708897244 | ImageFile = Cephaeline.svg | ImageClass = skin-invert-image | IUPACName = 7′,10,11-Trimethoxyemetan-6′-ol | SystematicName = (1''R'')-1-{[(2''S'',3''R'',11b''S'')-3-Ethyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2''H''-pyrido[2,1-''a'']isoquinolin-2-yl]methyl}-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol | OtherNames = Cepheline; Desmethylemetine; Dihydropsychotrine |Section1={{Chembox Identifiers | CASNo = 483-17-0 | CASNo_Ref = {{cascite|correct|CAS}} | ChEMBL = 255708 | ChEMBL_Ref = {{ebicite|correct|EBI}} | PubChem = 442195 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C09390 | UNII = QA971541A1 | UNII_Ref = {{fdacite|correct|FDA}} | ChemSpiderID = 390702 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | SMILES = CC[C@H]1CN2CCc3cc(c(cc3[C@@H]2C[C@@H]1C[C@@H]4c5cc(c(cc5CCN4)O)OC)OC)OC | StdInChI = 1S/C28H38N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3/t17-,20-,23+,24-/m0/s1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DTGZHCFJNDAHEN-OZEXIGSWSA-N | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} }} |Section2={{Chembox Properties | C=28 | H=38 | N=2 | O=4 | Appearance = White silky crystals | Density = | MeltingPt = | BoilingPt = | SolubleOther = Soluble{{vague|date=March 2015}} | Solvent = ethanol }} |Section3={{Chembox Hazards | MainHazards = Emetic / poisonous | FlashPt = | AutoignitionPt = }} }}
'''Cephaeline''' is an alkaloid that is found in ''Cephaelis ipecacuanha'' and other plant species including ''Psychotria acuminata''.<ref>{{cite news|url=http://www.accessmylibrary.com/article-1G1-119570434/micropropagaci195179n-de-la-planta.html|title=Micropropagacion de la planta medicinal psychotria acuminata|author1=Lara, Alfonso |author2=Valverde, Roberto |author3=Gomez, Luis |author4=Hidalgo, Nancy | date=July 1, 2003 |work=Agronomía Costarricense| accessdate=26 December 2009}}</ref> Cephaeline induces vomiting by stimulating the stomach lining and is found in commercial products such as syrup of ipecac.<ref>{{cite news|url=http://www.accessmylibrary.com/article-1G1-72449957/pharma-japan-approval-4.html|title=Pharma Japan: Approval of 4 drugs including Seroquel recommended: CPAC panel.|date=November 14, 2000 |work=Chemical Business Newsbase |accessdate=26 December 2009}}</ref> Chemically, it is closely related to emetine.
==Poison treatment== Cephaeline in the form of syrup of ipecac was once commonly recommended as an emergency treatment for accidental poisoning, but its use has been phased out due to its ineffectiveness.<ref>{{cite journal |journal=Pediatrics |volume=112 |issue=5 |date=November 2003 |pages=1182–1185 |title=Policy statement: Poison treatment in the home |doi=10.1542/peds.112.5.1182 |pmid=14595067 |doi-access=free |last1=American Academy Of Pediatrics Committee On Injury |first1=Violence }}</ref>
== References == {{Reflist}}
Category:Hydroxyarenes Category:Norsalsolinol ethers Category:Emetics Category:Drugs with no legal status Category:Tetrahydroisoquinoline alkaloids