{{cs1 config |name-list-style=vanc |display-authors=6}} {{Infobox drug | image = Cepentil.svg | image_class = skin-invert-image | width = 200px | image2 = Cepentil 3D.png | image_class2 = bg-transparent | width2 = 225px

<!-- Clinical data --> | tradename =

<!-- Legal status --> | legal_AU = | legal_CA = | legal_UK = | legal_US =

<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!-- Identifiers --> | CAS_number = | UNII = | ChEMBL = | PubChem = 171933571 | ChemSpiderID = 95545978 | synonyms = Tsepentil; ''N''-Cyclopentyllysergamide; NCPe-LA; ''N''-Cyclopentyl-lysergamide; LCyP; C<sub>5</sub>AL

<!-- Chemical data --> | IUPAC_name = N-cyclopentyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide | C=21 | H=25 | N=3 | O=1 | SMILES = CN1CC(C=C2C1CC3=CNC4=CC=CC2=C34)C(=O)NC5CCCC5 | StdInChI = 1S/C21H25N3O/c1-24-12-14(21(25)23-15-5-2-3-6-15)9-17-16-7-4-8-18-20(16)13(11-22-18)10-19(17)24/h4,7-9,11,14-15,19,22H,2-3,5-6,10,12H2,1H3,(H,23,25) | StdInChIKey = GIUWLXABHBAKDK-UHFFFAOYSA-N }}

'''Cepentil''', or '''Tsepentil''', also known as '''''N''-cyclopentyllysergamide''' ('''NCPe-LA''') or as '''lysergic acid cyclopentylamide''' ('''LCyP'''), is an analogue of LSD developed in the former Soviet Union which acts as an antagonist at serotonin receptors. It does not produce hallucinogen-like effects in animal studies, instead being described as an "energizer" by contemporary sources, suggesting an action similar to the antidementia drug hydergine, however the pharmacology of cepentil has not been studied with modern techniques.<ref name="pmid13545891">{{cite journal | vauthors = Votava Z, Podvalova I, Semonsky M | title = Studies on the pharmacology of D-lysergic acid cycloalkylamides | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 115 | issue = 1–2 | pages = 114–30 | date = May 1958 | pmid = 13545891 | doi = | url = }}</ref><ref>{{cite journal | vauthors = Zakusov VV | title = Pharmacology and chemistry | journal = Vestnik Akademii Meditsinskikh Nauk SSSR | date = January 1964 | volume = 19 | pages = 43–51 | pmid = 14203697 | language = Russian }}</ref><ref>{{cite book | vauthors = Usdin E, Efron DH | title = Psychotropic Drugs and Related Compounds | date = 1972 | pages = 94–95 | asin = B002X3CDIY | publisher = National Institute of Mental Health }}</ref><ref>{{cite book | vauthors = Sankar DV | title = LSD - A Total Study. | publisher = PJD Publications | date = 1975| pages = 150–152 | isbn = 0-9600290-3-6 }}</ref>

==See also== * Substituted lysergamide * Lysergic acid cyclobutylamide * Amesergide * LAE-32 * LPD-824 * LY-215840 * Lysergic acid 2-butyl amide * Lysergic acid 3-pentyl amide * List of Russian drugs

==References== {{Reflist}}

==External links== * [https://isomerdesign.com/pihkal/explore/5934 NCPe-LA - Isomer Design]

{{Serotonin receptor modulators}} {{Ergolines}}

Category:Carboxamides Category:Cyclopentyl compounds Category:Drugs in the Soviet Union Category:Lysergamides Category:Russian drugs Category:Serotonin receptor antagonists Category:Soviet inventions