{{Chembox | ImageFile = Cedrol skeletal.svg | ImageSize = | ImageAlt = | IUPACName = 8α-Cedran-8β-ol | SystematicName = (3''R'',3a''S'',6''R'',7''R'',8a''S'')-3,6,8,8-Tetramethyloctahydro-1''H''-3a,7-methanoazulen-6-ol | OtherNames = |Section1={{Chembox Identifiers | CASNo = 77-53-2 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 63ZM9703BO | PubChem = 65575 | ChemSpiderID = 59018 | ChEMBL = 1974890 | SMILES = O[C@@]2(CC[C@]31[C@@H](CC[C@H]1C)C([C@H]2C3)(C)C)C | StdInChI = 1S/C15H26O/c1-10-5-6-11-13(2,3)12-9-15(10,11)8-7-14(12,4)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12-,14-,15+/m1/s1 | StdInChIKey = SVURIXNDRWRAFU-OGMFBOKVSA-N }} |Section2={{Chembox Properties | C=15 | H=26 | O=1 | Appearance = | Density = 1.01 g/mL | MeltingPtC = 86 to 87 | MeltingPt_ref = <ref>{{Merck12th|id=1961}}</ref> | BoilingPtC = 273 | BoilingPt_ref = <ref>{{Aldrich|id=22135|name=(+)-Cedrol|accessdate=25 May 2011}}</ref> | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Cedrol''' is a sesquiterpene alcohol found in the essential oil of conifers (cedar oil), especially in the genera ''Cupressus'' (cypress) and ''Juniperus'' (juniper). It has also been identified in ''Origanum onites'', a plant related to oregano.<ref>{{cite book|editor=Connolly, JD |editor2=Hill, RA|title=Dictionary of Terpenoids |volume=1 Mono- and sesquiterpenoids|year=1991|publisher=Chapman&Hall|isbn=0-412-25770-X|at=SQ02555}}</ref> Its main uses are in the chemistry of aroma compounds.<ref>{{cite book|author=Breitmeier, E|title=Terpenes: flavors, fragrances, pharmaca, pheromones|year=2006|publisher=Wiley-VCH|isbn=3-527-31786-4|pages=46–47}}</ref> It makes up about 19% of cedarwood oil Texas and 15.8% of cedarwood oil Virginia.<ref>{{cite web|url=https://swiftcraftymonkey.blogspot.com/2012/02/essential-oils-cedarwood-science-of.html|title=Point of Interest!|author=Susan Barclay-Nichols|work=swiftcraftymonkey.blogspot.com}}</ref>
Cedrol has not been proven to be toxic in humans. It has been shown to have antioxidant and antiinflammatory along with other beneficial effects. In skin sensitization tests 2/20 people showed negative effects, and on the second test there was no sensitivity found. This compound and ones similar have been found to have antiseptic, anti-inflammatory, antispasmodic, tonic, astringent, diuretic, sedative, insecticidal, and antifungal activities ''in vitro''.<ref>{{Cite journal |pmid = 25343299|year = 2014|last1 = Jeong|first1 = H. U.|last2 = Kwon|first2 = S. S.|last3 = Kong|first3 = T. Y.|last4 = Kim|first4 = J. H.|last5 = Lee|first5 = H. S.|title = Inhibitory effects of cedrol, β-cedrene, and thujopsene on cytochrome P450 enzyme activities in human liver microsomes|journal = Journal of Toxicology and Environmental Health. Part A|volume = 77|issue = 22–24|pages = 1522–32|doi = 10.1080/15287394.2014.955906}}</ref> These compounds are used globally in traditional medicine and cosmetics.<ref name="Cedrol toxicity">{{cite web | url = https://www.nlm.nih.gov/toxnet/index.html | title = Cedrol | work = TOXNET: Toxicology Data Network}}</ref> Results of a 2015 study suggest that cedrol strongly attracts pregnant female mosquitoes after they have fed, which can be used to create cedrol-baited traps.<ref>{{cite journal | url=http://www.sciguru.org/newsitem/18734/cedrol-naturally-occurring-bait-malaria-spreading-pregnant-mosquitoes | title=Discovery of an oviposition attractant for gravid malaria vectors of the Anopheles gambiae species complex |author1=Lindh, Jenny |author2=Okal, Michael | journal=Malaria Journal |date=March 2015 | volume=14 | issue=119 | pages=119 | doi=10.1186/s12936-015-0636-0| pmid=25885703 | pmc=4404675 | doi-access=free }}</ref>
== See also == * Cedrene, another component of cedar oil
== References == {{reflist}}
Category:Sesquiterpenes