{{Short description|Chemical compound}} {{infobox drug | drug_name = Carperidine | image = Carperidine.svg | image_class = skin-invert-image | legal_UK = | legal_DE = | C = 17 | H = 24 | N = 2 | O = 3 | IUPAC_name = ethyl 1-(3-amino-3-oxopropyl)-4-phenylpiperidine-4-carboxylate | CAS_number = 7528-13-4 | CAS_number_Ref = {{cascite|correct|CAS}} | ChEMBL = 2104584 | ChemSpiderID = 22571 | PubChem = 24149 | UNII = LZ6E4G9827 | smiles = CCOC(=O)C1(CCN(CC1)CCC(=O)N)C2=CC=CC=C2 | StdInChI = 1S/C17H24N2O3/c1-2-22-16(21)17(14-6-4-3-5-7-14)9-12-19(13-10-17)11-8-15(18)20/h3-7H,2,8-13H2,1H3,(H2,18,20) | StdInChIKey = IXZCNCWEDOHVLK-UHFFFAOYSA-N }}
'''Carperidine''' ('''carbamethidine''') is an opioid analgesic drug related to meperidine. It has analgesic and antitussive effects with similar potency to codeine, though several related compounds are significantly more potent.<ref>{{cite patent | url = https://patents.google.com/patent/US3117139A | inventor = Aram M | assign1 = Sterling Drug, Inc. | title = 4-aryl-1-carbamylalkyl-piperidines. | country = US | number = 117139 | gdate = 7 January 1964 | postscript = . }}</ref><ref>{{cite book | vauthors = List PH, Hürhammer L | date = 1973 | chapter = C, Sachverzeichnis für die Bände I–III, VIIA | pages = 56–82 | title = Hagers Handbuch der Pharmazeutischen Praxis (Für Apotheker, Arzneimittelhersteller Ärzte und Medizinalbeamte) | volume = 1,2,3,7A | publisher = Springer | location = Berlin, Heidelberg | doi = 10.1007/978-3-642-67660-4_3 }}</ref><ref name="pmid33608948">{{cite journal | vauthors = Richards GC, Sitkowski K, Heneghan C, Aronson JK | title = The Oxford Catalogue of Opioids: A systematic synthesis of opioid drug names and their pharmacology | journal = British Journal of Clinical Pharmacology | volume = 87 | issue = 10 | pages = 3790–3812 | date = October 2021 | pmid = 33608948 | pmc = 8518704 | doi = 10.1111/bcp.14786 }}</ref>
== See also == * Etoxeridine * Furethidine * Piminodine
== References == {{reflist}}
Category:Amides Category:Esters Category:Piperidines Category:Ethyl esters
{{analgesic-stub}}