{{Chembox | ImageFile = Canolol.svg | ImageSize = 150px | ImageAlt = Chemical structure of canolol | PIN = 4-Ethenyl-2,6-dimethoxyphenol | OtherNames = 2,6-Dimethoxy-4-vinylphenol <br />4-Vinyl-2,6-dimethoxyphenol<br />4-Vinylsyringol |Section1={{Chembox Identifiers | CASNo = 28343-22-8 | CASNo_Ref = {{cascite|correct|CAS}} | ChEBI = 197097 | ChemSpiderID = 33074 | EC_number = 848-947-6 | PubChem = 35960 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = ZB5OK5EX8B | StdInChI=1S/C10H12O3/c1-4-7-5-8(12-2)10(11)9(6-7)13-3/h4-6,11H,1H2,2-3H3 | StdInChIKey = QHJGZUSJKGVMTF-UHFFFAOYSA-N | SMILES = C=Cc1cc(OC)c(O)c(OC)c1 }} |Section2={{Chembox Properties | C=10 | H=12 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/35960#section=Safety-and-Hazards] | GHSPictograms = {{GHS05}}{{GHS07}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|315|318|335}} | PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+354+338|317|319|321|332+317|362+364|403+233|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Canolol''' is a phenolic compound found in crude canola oil.<ref>{{cite journal | doi = 10.1021/jp2022105 | title = Canolol: A Promising Chemical Agent against Oxidative Stress | date = 2011 | last1 = Galano | first1 = Annia | last2 = Francisco-Márquez | first2 = Misaela | last3 = Alvarez-Idaboy | first3 = Juan R. | journal = The Journal of Physical Chemistry B | volume = 115 | issue = 26 | pages = 8590–8596 | pmid = 21619069 }}</ref><ref>{{cite journal | pmid = 18059022 | date = 2008 | last1 = Cao | first1 = X. | last2 = Tsukamoto | first2 = T. | last3 = Seki | first3 = T. | last4 = Tanaka | first4 = H. | last5 = Morimura | first5 = S. | last6 = Cao | first6 = L. | last7 = Mizoshita | first7 = T. | last8 = Ban | first8 = H. | last9 = Toyoda | first9 = T. | last10 = Maeda | first10 = H. | last11 = Tatematsu | first11 = M. | title = 4-Vinyl-2,6-dimethoxyphenol (Canolol) suppresses oxidative stress and gastric carcinogenesis in Helicobacter pylori-infected carcinogen-treated Mongolian gerbils | journal = International Journal of Cancer | volume = 122 | issue = 7 | pages = 1445–1454 | doi = 10.1002/ijc.23245 }}</ref> It is produced by decarboxylation of sinapic acid during canola seed roasting.<ref>{{cite journal | doi = 10.1039/C3GC40748A | title = Antioxidant canolol production from a renewable feedstock via an engineered decarboxylase | date = 2013 | last1 = Morley | first1 = Krista L. | last2 = Grosse | first2 = Stephan | last3 = Leisch | first3 = Hannes | last4 = Lau | first4 = Peter C. K. | journal = Green Chemistry | volume = 15 | issue = 12 | page = 3312 }}</ref><ref>{{cite journal | doi = 10.1021/jf301738y | title = Isolation and Identification of a Potent Radical Scavenger (Canolol) from Roasted High Erucic Mustard Seed Oil from Nepal and Its Formation during Roasting | date = 2012 | last1 = Shrestha | first1 = Kshitij | last2 = Stevens | first2 = Christian V. | last3 = De Meulenaer | first3 = Bruno | journal = Journal of Agricultural and Food Chemistry | volume = 60 | issue = 30 | pages = 7506–7512 | pmid = 22746294 | bibcode = 2012JAFC...60.7506S }}</ref>
== See also == {{Div col|colwidth=16em}} *Phenolic content in wine *Syringaldehyde *Syringol *Syringic acid *Acetosyringone *Sinapyl alcohol *Sinapaldehyde *Sinapinic acid *Sinapine {{Div col end}}
== References == {{reflist}}
Category:O-methylated natural phenols Category:Vinyl compounds Category:Vegetable oils
{{phenol-stub}}