{{Chembox | ImageFile = Pelargonidin 3-O-glucoside.svg | ImageSize = 250px | ImageAlt = Chemical structure of callistephin | IUPACName = 5,7‐Dihydroxy‐2‐(4‐hydroxyphenyl)‐3‐{[(2''S'',3''R'',4''S'',5''S'',6''R'')‐3,4,5‐trihydroxy‐6‐(hydroxymethyl)oxan‐2‐yl]oxy}‐1λ<sup>4</sup>‐chromen‐1‐ylium | SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl β-<small>D</small>-glucopyranoside | OtherNames = Pelargonidin-3-O-glucoside |Section1={{Chembox Identifiers | CASNo = 47684-27-5 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = W623YHH61A | PubChem = 443648 | ChEBI = 31967 | SMILES = C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O | ChemSpiderID = 391782 | InChI = 1/C21H20O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-22,26-28H,8H2,(H2-,23,24,25)/p+1/t16-,17-,18+,19-,21-/m1/s1 | InChIKey = ABVCUBUIXWJYSE-OAYIZRCEBP | StdInChI = 1S/C21H20O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-22,26-28H,8H2,(H2-,23,24,25)/p+1/t16-,17-,18+,19-,21-/m1/s1 | StdInChIKey = ABVCUBUIXWJYSE-GQUPQBGVSA-O | KEGG = C12137 }} |Section2={{Chembox Properties | C=21 | H=21 | O=10 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = | LambdaMax = 505 nm<ref>{{cite journal | doi = 10.3390/molecules17021571 | doi-access = free | title = Anthocyanins and Their Variation in Red Wines I. Monomeric Anthocyanins and Their Color Expression | date = 2012 | last1 = He | first1 = Fei | last2 = Liang | first2 = Na-Na | last3 = Mu | first3 = Lin | last4 = Pan | first4 = Qiu-Hong | last5 = Wang | first5 = Jun | last6 = Reeves | first6 = Malcolm J. | last7 = Duan | first7 = Chang-Qing | journal = Molecules | volume = 17 | issue = 2 | pages = 1571–1601 | pmid = 22314380 | pmc = 6268338 }}</ref> }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Callistephin''' is an anthocyanin. It is the 3-''O''-glucoside of pelargonidin.
It is found in pomegranate juice,<ref>{{cite journal | doi = 10.1007/s002170050529| title = Evolution of juice anthocyanins during ripening of new selected pomegranate ( Punica granatum ) clones| date = 1999| last1 = Hernández| first1 = F.| last2 = Melgarejo| first2 = P.| last3 = Tomás-Barberán| first3 = F. A.| last4 = Artés| first4 = F.| journal = European Food Research and Technology| volume = 210| pages = 39–42| s2cid = 16524540}}</ref> in strawberries,<ref>{{Cite journal |doi=10.1021/jf072000p |title=Bioavailability of Pelargonidin-3-O-glucoside and Its Metabolites in Humans Following the Ingestion of Strawberries with and without Cream |year=2008 |last1=Mullen |first1=William |last2=Edwards |first2=Christine A. |last3=Serafini |first3=Mauro |last4=Crozier |first4=Alan |journal=Journal of Agricultural and Food Chemistry |volume=56 |issue=3 |pages=713–9 |pmid=18211024}}</ref> and in purple corn.<ref>{{cite journal | title = Anthocyanins isolated from purple corn (Zea mays L.) | journal = Agricultural and Food Sciences | author = Hiromitsu Aoki, Noriko Kuze and Yoshiaki Kato | url = http://www.ffcr.or.jp/zaidan/ffcrhome.nsf/7bd44c20b0dc562649256502001b65e9/c6698773361b42b249256ba60018e581/$FILE/anthocyanin-FFIJ199.pdf | archive-date = 2013-10-29 | access-date = 2014-02-09 | archive-url = https://web.archive.org/web/20131029210237/http://www.ffcr.or.jp/zaidan/ffcrhome.nsf/7bd44c20b0dc562649256502001b65e9/c6698773361b42b249256ba60018e581/$FILE/anthocyanin-FFIJ199.pdf | url-status = dead }})</ref> It is also found in the berry skins of Cabernet Sauvignon and Pinot Noir grapes ''(Vitis vinifera'' L.).<ref>{{cite journal | doi = 10.1111/j.1755-0238.2010.00107.x | title = Mass-spectrometry evidence confirming the presence of pelargonidin-3-O-glucoside in the berry skins of Cabernet Sauvignon and Pinot Noir (Vitis vinifera L.) | date = 2010 | last1 = He | first1 = F. | last2 = He | first2 = J.-J. | last3 = Pan | first3 = Q.-H. | last4 = Duan | first4 = C.-Q. | journal = Australian Journal of Grape and Wine Research | volume = 16 | issue = 3 | pages = 464–468 | doi-access = free }}</ref>
== See also == * ''Callistephus''
== References == {{reflist}}
{{Anthocyanidin}}
Category:Anthocyanins Category:Flavonoid glucosides
{{aromatic-stub}}