{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one | image = CYM50769_structure.png | image_class = skin-invert-image

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | IUPHAR_ligand = | CAS_number = 1421365-63-0 | ATC_prefix = none | ATC_suffix = | PubChem = 50904505 | ChemSpiderID = 28494696 | ChEMBL = 1972527 | UNII = <!--Chemical data--> | C=24 | H=17 | Cl=1 | N=2 | O=3 | StdInChI=1S/C24H17ClN2O3/c1-29-15-10-12-16(13-11-15)30-23-21(25)14-26-27(24(23)28)22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-14,22H,1H3 | StdInChIKey = QHVSQUYCVUHYKT-UHFFFAOYSA-N | SMILES = COC1=CC=C(C=C1)OC2=C(C=NN(C2=O)C3C4=CC=CC=C4C5=CC=CC=C35)Cl }}

'''CYM50769''' is a drug which acts as a selective, non-peptide antagonist at the Neuropeptides B/W receptor NPBW1. It is used for fundamental research into the structure and function of the NPBW1 receptor, and has antidepressant effects in animal studies.<ref>{{cite journal | vauthors = Urbano M, Guerrero M, Zhao J, Velaparthi S, Saldanha SA, Chase P, Wang Z, Civelli O, Hodder P, Schaeffer MT, Brown S, Rosen H, Roberts E | title = Design, synthesis and SAR analysis of novel potent and selective small molecule antagonists of NPBWR1 (GPR7) | journal = Bioorganic & Medicinal Chemistry Letters | volume = 22 | issue = 23 | pages = 7135–7141 | date = December 2012 | pmid = 23079522 | doi = 10.1016/j.bmcl.2012.09.074 | pmc = 3601546 }}</ref><ref>{{cite journal | vauthors = Guerrero M, Urbano M, Schaeffer MT, Brown S, Rosen H, Roberts E | title = SAR analysis of novel non-peptidic NPBWR1 (GPR7) antagonists | journal = Bioorganic & Medicinal Chemistry Letters | volume = 23 | issue = 3 | pages = 614–619 | date = February 2013 | pmid = 23287738 | doi = 10.1016/j.bmcl.2012.12.030 | pmc = 3621982 }}</ref><ref>{{cite journal | vauthors = Stein G, Aly JS, Lange L, Manzolillo A, Riege K, Brancato A, Hübner CA, Turecki G, Hoffmann S, Engmann O | title = Npbwr1 signaling mediates fast antidepressant action | journal = Molecular Psychiatry | volume = 30 | issue = 5 | pages = 1828–1835 | date = May 2025 | pmid = 39433904 | doi = 10.1038/s41380-024-02790-4 | pmc = 12015170 }}</ref>

== References == {{Reflist}}

Category:Pyridazines Category:Chloroarenes Category:Lactams Category:Fluorenes Category:4-Methoxyphenyl compounds

{{nervous-system-drug-stub}}