{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451224368 | image = CP-809101 Structure.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 479683-64-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = A2EXW95647 | ATC_prefix = None | ATC_suffix = | PubChem = 9901086 | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 8076740
<!--Chemical data--> | IUPAC_name = 2-[(3-Chlorophenyl)methoxy]-6-(1-piperazinyl)pyrazine | C=15 | H=17 | Cl=1 | N=4 | O=1 | SMILES = C2CNCCN2c(n3)cncc3OCc(c1)cccc1Cl | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C15H17ClN4O/c16-13-3-1-2-12(8-13)11-21-15-10-18-9-14(19-15)20-6-4-17-5-7-20/h1-3,8-10,17H,4-7,11H2 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = PCWGGOVOEWHPMG-UHFFFAOYSA-N
| melting_point = | melting_high = }}
'''CP-809101''' is a drug which acts as a potent and highly selective serotonin 5-HT<sub>2C</sub> receptor full agonist.<ref name="pmid19037632">{{cite journal |vauthors=Strong PV, Greenwood BN, Fleshner M |title=The effects of the selective 5-HT(2C) receptor antagonist SB 242084 on learned helplessness in male Fischer 344 rats |journal=Psychopharmacology |volume=203 |issue=4 |pages=665–75 |date=May 2009 |pmid=19037632 |doi=10.1007/s00213-008-1413-3 |s2cid=24956531 }}</ref> It had promising results in animal models of obesity and psychosis, but associated with genotoxicity which means that future use will be restricted to scientific research applications only.<ref name="SiuciakChapinMcCarthy2007" /><ref name="pmid17344339">{{cite journal |vauthors=Kalgutkar AS, Dalvie DK, Aubrecht J, Smith EB, Coffing SL, Cheung JR, Vage C, Lame ME, Chiang P, McClure KF, Maurer TS, Coelho RV, Soliman VF, Schildknegt K |title=Genotoxicity of 2-(3-chlorobenzyloxy)-6-(piperazinyl)pyrazine, a novel 5-hydroxytryptamine2c receptor agonist for the treatment of obesity: role of metabolic activation |journal=Drug Metabolism and Disposition |volume=35 |issue=6 |pages=848–58 |date=June 2007 |pmid=17344339 |doi=10.1124/dmd.106.013649 |s2cid=29863246 |url=http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |archive-url=https://web.archive.org/web/20190225184746/http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |url-status=dead |archive-date=2019-02-25 }}</ref>
The drug has more than three orders of magnitude lower potency as an agonist of the serotonin 5-HT<sub>2A</sub> receptor compared to the serotonin 5-HT<sub>2C</sub> receptor as well as lower efficacy at the receptor in comparison ({{Abbrlink|E<sub>max</sub>|maximal efficacy}} = 93% and 67%, respectively).<ref name="SiuciakChapinMcCarthy2007">{{cite journal | vauthors = Siuciak JA, Chapin DS, McCarthy SA, Guanowsky V, Brown J, Chiang P, Marala R, Patterson T, Seymour PA, Swick A, Iredale PA | title = CP-809,101, a selective 5-HT2C agonist, shows activity in animal models of antipsychotic activity | journal = Neuropharmacology | volume = 52 | issue = 2 | pages = 279–290 | date = February 2007 | pmid = 16949622 | doi = 10.1016/j.neuropharm.2006.07.024 | url = }}</ref> It did not produce the head-twitch response in rodents, and was able to antagonize the head-twitch response induce by the psychedelic drug (–)-DOI.<ref name="SiuciakChapinMcCarthy2007" />
==References== {{Reflist}}
{{Serotonin receptor modulators}}
Category:5-HT2C agonists Category:Aromatic ethers Category:3-Chlorophenyl compounds Category:Drugs developed by Pfizer Category:1-Piperazinyl compounds Category:Pyrazines
{{Nervous-system-drug-stub}}