{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 435160000 | ImageFile = CP154526.svg | ImageClass = skin-invert-image | ImageSize = 200px | PIN = ''N''-Butyl-''N''-ethyl-2,5-dimethyl-7-(2,4,6-trimethylphenyl)-7''H''-pyrrolo[3,2-''e'']pyrimidin-4-amine | OtherNames = |Section1={{Chembox Identifiers | IUPHAR_ligand = 3495 | CASNo_Ref = {{cascite|correct|??}} | CASNo=157286-86-7 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 9A549FB00R | PubChem=5311055 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 9946 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4470592 | InChI = 1/C23H32N4/c1-8-10-11-26(9-2)22-20-18(6)14-27(23(20)25-19(7)24-22)21-16(4)12-15(3)13-17(21)5/h12-14H,8-11H2,1-7H3 | InChIKey = FHQYJZCJRZHINA-UHFFFAOYAW | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C23H32N4/c1-8-10-11-26(9-2)22-20-18(6)14-27(23(20)25-19(7)24-22)21-16(4)12-15(3)13-17(21)5/h12-14H,8-11H2,1-7H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = FHQYJZCJRZHINA-UHFFFAOYSA-N | SMILES=CCCCN(CC)C1=NC(=NC2=C1C(=CN2C3=C(C=C(C=C3C)C)C)C)C }} |Section2={{Chembox Properties | Formula=C<sub>23</sub>H<sub>32</sub>N<sub>4</sub> | MolarMass=364.52698 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} '''CP-154,526''' is a potent and selective [[receptor antagonist|antagonist]] of the [[corticotropin releasing hormone receptor 1]] developed by [[Pfizer]].<ref name="pmid8816826">{{cite journal | vauthors = Schulz DW, Mansbach RS, Sprouse J, Braselton JP, Collins J, Corman M, Dunaiskis A, Faraci S, Schmidt AW, Seeger T, Seymour P, Tingley FD, Winston EN, Chen YL, Heym J | title = CP-154,526: a potent and selective nonpeptide antagonist of corticotropin releasing factor receptors | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 93 | issue = 19 | pages = 10477–82 | date = September 1996 | pmid = 8816826 | pmc = 38410 | doi = 10.1073/pnas.93.19.10477 | bibcode = 1996PNAS...9310477S | doi-access = free }}</ref>

CP-154,526 is under investigation for the potential treatment of [[alcoholism]].<ref name="urlDrug Has Potential To Prevent Alcoholics From Relapsing">{{cite web | url = https://www.sciencedaily.com/releases/2008/07/080730175518.htm | title = Drug Has Potential To Prevent Alcoholics From Relapsing | date = 2008-08-02 | work = Science News | publisher = ScienceDaily | access-date = 2008-08-09}}</ref><ref name="pmid18591672">{{cite journal | vauthors = Pastor R, McKinnon CS, Scibelli AC, Burkhart-Kasch S, Reed C, Ryabinin AE, Coste SC, Stenzel-Poore MP, Phillips TJ | title = Corticotropin-releasing factor-1 receptor involvement in behavioral neuroadaptation to ethanol: a urocortin1-independent mechanism | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 105 | issue = 26 | pages = 9070–5 | date = July 2008 | pmid = 18591672 | pmc = 2449366 | doi = 10.1073/pnas.0710181105 | bibcode = 2008PNAS..105.9070P | doi-access = free }}</ref>

== See also == * [[Antalarmin]] * [[Pexacerfont]] * [[Corticotropin releasing hormone antagonist]]

== References == {{Reflist|2}}

== Further reading == * {{cite journal | vauthors = Seymour PA, Schmidt AW, Schulz DW | title = The pharmacology of CP-154,526, a non-peptide antagonist of the CRH1 receptor: a review | journal = CNS Drug Reviews | volume = 9 | issue = 1 | pages = 57–96 | year = 2006 | pmid = 12595912 | doi = 10.1111/j.1527-3458.2003.tb00244.x | pmc = 6741649 }} * {{cite journal | vauthors = Navarro-Zaragoza J, Núñez C, Laorden ML, Milanés MV | title = Effects of corticotropin-releasing factor receptor-1 antagonists on the brain stress system responses to morphine withdrawal | journal = Molecular Pharmacology | volume = 77 | issue = 5 | pages = 864–73 | date = May 2010 | pmid = 20159948 | doi = 10.1124/mol.109.062463 | s2cid = 18588298 }} * {{cite journal | vauthors = Kobayashi T, Kiyokawa Y, Takeuchi Y, Mori Y | title = Pretreatment with CP-154526 blocks the modifying effects of alarm pheromone on components of sexual behavior in male, but not in female, rats | journal = Chemical Senses | volume = 36 | issue = 7 | pages = 623–32 | date = September 2011 | pmid = 21502338 | doi = 10.1093/chemse/bjr017 | doi-access = free }}

== External links == * {{MeshName|CP+154526}}

{{Antidepressants}} {{Anxiolytics}}

{{DEFAULTSORT:Cp-154, 526}} [[Category:Anxiolytics]] [[Category:Corticotropin-releasing hormone antagonists]] [[Category:Pyrrolopyrimidines]] [[Category:Drugs developed by Pfizer]]

{{Anxiolytic-stub}}