{{Chembox | ImageFile = Brevifolin.svg | ImageSize = 200px | PIN = 1-(2-Hydroxy-4,6-dimethoxyphenyl)ethan-1-one | OtherNames = {{ubl|2-Hydroxy-4,6-dimethoxyacetophenone|Phloroacetophenone 2,4-dimethyl ether|Xanthoxylin|Xanthoxyline}} |Section1={{Chembox Identifiers | CASNo = 90-24-4 | CASNo_Ref = {{cascite|correct|CAS}} | ChEBI = 10070 | ChEMBL = 450288 | DTXSID = 10237981 | KEGG = C10726 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Z8RSY5TZPA | PubChem = 66654 | ChemSpiderID = 60021 | SMILES = CC(=O)C1=C(C=C(C=C1OC)OC)O | InChI = 1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 | InChIKey = FBUBVLUPUDBFME-UHFFFAOYAY | StdInChI = 1S/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 | StdInChIKey = FBUBVLUPUDBFME-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=10 | H=12 | O=4 | Appearance = solid | Density = | MeltingPt = 85-88 °C<ref>{{Cite web |last=PubChem |title=Xanthoxylin |url=https://pubchem.ncbi.nlm.nih.gov/compound/66654 |access-date=2025-12-17 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|H315|H319|H335}} | PPhrases = {{P-phrases|P261|P264|P264+P265|P271|P280|P302+P352|P304+P340|P305+P351+P338|P319|P321|P332+P317|P337+P317|P362+P364|P403+P233|P405|P501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Brevifolin''' or '''xanthoxylin''' is a bioactive compound found in pomegranate.<ref>{{cite journal|title=Tannins from the leaves of Punica granatum|journal=Phytochemistry|volume=45|issue=4|pages=819–823|doi=10.1016/S0031-9422(96)00888-6|year=1997|last1=Hussein|first1=Sahar A.M|last2=Barakat|first2=Heba H|last3=Merfort|first3=Irmgard|last4=Nawwar|first4=Mahmoud A.M}}</ref> The pharmacological profile of brevifolin is reported similar to ellagic acid, particularly with regards to absorption, distribution, and elimination rates.<ref>{{cite journal | url =http://europepmc.org/abstract/CBA/520721/reload=0;jsessionid=NAedJpDvEYUiEbNhuL5B.0 | title = Determination and pharmacokinetic study of brevifolin in rat after ig administration of pomegranate leaf extract | journal = Chinese Pharmacological Bulletin | date = 2005 | volume = 21 | issue = 3 | pages = 369–372}}</ref>

== References == {{reflist}}

Category:Aromatic ketones Category:Natural phenols Category:Pomegranates

{{aromatic-stub}}