{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | INN = | type = <!-- empty --> | image = Bexirestrant.svg | image_class = skin-invert-image | width = | alt = | caption = | image2 = | width2 = | alt2 = | caption2 = | imageL = | widthL = | altL = | imageR = | widthR = | altR = | captionLR =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = <!-- Health Canada may use generic or brand name (generic name preferred) --> | licence_EU = <!-- EMA uses INN (or special INN_EMA) --> | DailyMedID = <!-- DailyMed may use generic or brand name (generic name preferred) --> | licence_US = <!-- FDA may use generic or brand name (generic name preferred) --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU_comment = | pregnancy_category= | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATCvet = | ATC_prefix = <!-- 'none' if uncategorised --> | ATC_suffix = | ATC_supplemental =
<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C5, D1, D2, E, F1, F2, F3, F4 --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | legal_UK_comment = | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | legal_UN_comment = | legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action= | excretion =
<!-- Identifiers --> | CAS_number = 2505067-70-7 | CAS_supplemental = | PubChem = 155770216 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 115010413 | UNII = BB35H436NB | KEGG = | ChEBI = | ChEMBL = 5095057 | NIAID_ChemDB = | PDB_ligand = | synonyms = SCO-120
<!-- Chemical and physical data --> | IUPAC_name = <nowiki>(2S)-3-(3,5-difluorophenyl)-2-[4-[(E)-3-[3-(fluoromethyl)azetidin-1-yl]prop-1-enyl]phenyl]-4-methyl-2H-chromen-7-ol</nowiki> | C= 29 | H= 26 | F= 3 | N= 1 | O= 2 | molecular_weight = | SMILES = CC1=C([C@@H](OC2=C1C=CC(=C2)O)C3=CC=C(C=C3)/C=C/CN4CC(C4)CF)C5=CC(=CC(=C5)F)F | Jmol = | StdInChI = InChI=1S/C29H26F3NO2/c1-18-26-9-8-25(34)14-27(26)35-29(28(18)22-11-23(31)13-24(32)12-22)21-6-4-19(5-7-21)3-2-10-33-16-20(15-30)17-33/h2-9,11-14,20,29,34H,10,15-17H2,1H3/b3-2+/t29-/m0/s1 | StdInChI_comment = | StdInChIKey = DVZLOPUYTKPWHJ-MPWQXXDYSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}
'''Bexirestrant''' is a selective estrogen receptor degrader (SERD) which is being evaluated for the treatment of breast cancer. This orally bioavailable compound has demonstrated potent activity against both wild-type and mutant forms of the estrogen receptor (ER), addressing a critical need in overcoming resistance to current endocrine therapies.<ref name="Min_2024">{{cite journal | vauthors = Min J, Liu X, Peng R, Chen CC, Wang W, Guo RT | title = New generation estrogen receptor-targeted agents in breast cancer: present situation and future prospectives | journal = Acta Materia Medica | volume = 3 | issue = 1 | pages = 57–71 | date = February 2024 | pmid = 39373009 | pmc = 11450757 | doi = 10.15212/amm-2024-0006 }}</ref>
It is structurally characterized by an E-alkene linked to an azetidine core.
== References == {{reflist}}
{{antineoplastic-drug-stub}}
Category:Antineoplastic drugs Category:Selective estrogen receptor degraders Category:Azetidines Category:Benzopyrans Category:Organofluorides Category:Fluorobenzene derivatives Category:Phenols Category:Vinylbenzenes