{{Short description|Opioid analgesic}} {{lowercase title}} {{Drugbox | drug_name = β-Methylfentanyl | verifiedrevid = 443422397 | IUPAC_name = ''N''-Phenyl-''N''-[1-(2-phenylpropyl)piperidin-4-yl]propanamide | image = Betamethylfentanyl.svg | image_class = skin-invert-image | width = 140px | image2 = B-methylfentanyl 3D BS.png | image_class2 = bg-transparent | width2 = 220px

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = Schedule I<ref name=pmid29932611>{{cite journal | title = Schedules of Controlled Substances:Temporary Placement of Fentanyl-Related Substances in Schedule I. Temporary amendment; temporary scheduling order | journal = Federal Register | volume = 83 | issue = 25 | pages = 5188–92 | date = February 2018 | pmid = 29932611 | last1 = Drug Enforecement Administration | first1 = Department of Justice }}</ref> | legal_status = | routes_of_administration = <!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 79146-56-8 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 9658A8O6GK | ATC_prefix = none | ATC_suffix = | PubChem = 6425761 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4931228 <!--Chemical data--> | C=23 | H=30 | N=2 | O=1 | smiles = O=C(N(c1ccccc1)C3CCN(CC(c2ccccc2)C)CC3)CC | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = UXIGUKSHASXDNI-UHFFFAOYSA-N | synonyms = β-Methylfentanyl }}

'''β-Methylfentanyl''' is an opioid analgesic that is an analogue of fentanyl.

β-Methylfentanyl was sold briefly on the black market in the early 1980s, before the introduction of the Federal Analog Act which, for the first time, attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.<ref>{{cite journal | vauthors = Henderson GL | title = Designer drugs: past history and future prospects | journal = Journal of Forensic Sciences | volume = 33 | issue = 2 | pages = 569–75 | date = March 1988 | pmid = 3286815 | doi = 10.1520/JFS11976J }}</ref>

right|thumb|300px|The chemical structure of fentanyl has been used as a basis in modern chemistry for the discovery and nomenclature of many new fentanyl analogues, sometimes called fentalogs.

β-Methylfentanyl has similar effects to fentanyl.<ref>{{Cite web|title=3-Methylfentanyl|url=https://www.drugbank.ca/drugs/DB01571|access-date=2020-07-25|website=www.drugbank.ca}}</ref> Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.<ref>{{cite journal | vauthors = Mounteney J, Giraudon I, Denissov G, Griffiths P | title = Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe | journal = The International Journal on Drug Policy | volume = 26 | issue = 7 | pages = 626–31 | date = July 2015 | pmid = 25976511 | doi = 10.1016/j.drugpo.2015.04.003 | url = http://www.ijdp.org/article/S0955-3959%2815%2900097-3/abstract | url-access = subscription }}</ref>

== References == {{Reflist}}

{{Opioidergics}}

{{DEFAULTSORT:Methylfentanyl, β-}} Category:Synthetic opioids Category:Piperidines Category:Propionamides Category:Anilides Category:Mu-opioid receptor agonists