{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 459532473 | IUPAC_name = Phenylmethyl 2-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxybenzoate | image = Benexate.svg | image_class = skin-invert-image

<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|benexate}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = Rx-only | routes_of_administration = Oral

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 78718-52-2 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | ChEMBL = CHEMBL2104696 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = IAXUQWSLRKIRFR-UHFFFAOYSA-N | PubChem = 2316 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2226 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = O3PR2X907M

<!--Chemical data--> | C=23 | H=27 | N=3 | O=4 | smiles = O=C(OCc1ccccc1)c3ccccc3OC(=O)C2CCC(C/N=C(\N)N)CC2 }}

'''Benexate''' (BEX) is an anti-ulcer agent used in the treatment of acid-related disorders. It is unique in its inability to form salts that are both non-bitter and soluble.<ref>{{cite journal | vauthors = Hori Y, Odaguchi K, Jyoyama H, Yasui K, Mizui T | title = Differential effect of benexate hydrochloride betadex on prostaglandin levels in stomach and inflammatory sites in rats | journal = Japanese Journal of Pharmacology| issue = 2 | pages = 183–190 | date = 1996| volume = 72 | pmid = 8912919| doi = 10.1254/jjp.72.183 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Muranushi N, Yoshida M, Kinoshita H, Hirose F, Fukuda T, Doteuchi M, Yamada H | title = Studies of benexate CD: effect of inclusion compound formation on the antiulcer activity of benexate, the effective ingredient of benexate CD. | journal = Folia Pharmacologica Japonica | issue = 91| pages = 377–383 | date = 1998 }}</ref>

== Medical uses == Benexate is approved from treatment of gastric ulcer in Japan.<ref>{{cite web | url = https://drugs.ncats.io/drug/O3PR2X907M | title = Benexate | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref>

== Mechanism of action == The mechanism of action of benexate involves promotion of prostaglandin synthesis, protein secretion, and blood flow stimulation in the gastrointestinal tract.<ref>{{cite journal | title = Benexate hydrochloride betadex modulates nitric oxide synthesis and cytokine expression in gastric ulcers| year = 2016| pmid = 27446246| doi = 10.3892/etm.2016.3384 | pmc = 4950842 |vauthors=Lee JM, Lim J, Kim Y, Kim YJ, Choi HS, Kim ES, Keum B, Seo YS, Jeen YT, Lee HS, Um SH, Kim CD, Ryu HS, Sul D, Hong J, Chun HJ | journal = Experimental and Therapeutic Medicine| volume = 12| issue = 2| pages = 573–580 |name-list-style=vanc}}</ref>

==See also== * Famotidine * Powder diffraction * Sugar substitute * Crystal engineering

== References == {{Reflist}}

==Further reading== * {{Cite book |title=Advances in Organic Crystal Chemistry: Comprehensive Reviews 2015 |date=2015|editor=Rui Tamura, Mikiji Miyata | publisher = Springer Japan |doi=10.1007/978-4-431-55555-1| isbn=978-4-431-55554-4 |s2cid=93141904|url= https://www.springer.com/gp/book/9784431555544|edition=1st}}

Category:Drugs acting on the gastrointestinal system and metabolism Category:Guanidines Category:Salicylate esters Category:Salicylyl esters Category:Cyclohexanes