{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 460421310 | Name = Bacillithiol | Reference = | ImageFile = Bacillithiol structure.svg | ImageSize = 200px | ImageName = Structure of bacillithiol | IUPACName = (2''S'')-2-[2-(<small>L</small>-Cysteinamido)-2-deoxy-α-<small>D</small>-glucopyranosyloxy]butanedioic acid | SystematicName = (2''S'')-2-({(2''R'',3''R'',4''R'',5''S'',6''R'')-3-[(2''R'')-2-Amino-3-sulfanylpropanamido]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)butanedioic acid | OtherNames = | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|changed|??}} | CASNo = 1184928-91-3 | Abbreviations = BSH, Cys-GlcN-mal | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 61338 | PubChem = 42614123 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 24604693 | SMILES = C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H](CC(=O)O)C(=O)O)NC(=O)[C@H](CS)N)O)O)O | InChI = 1/C13H22N2O10S/c14-4(3-26)11(21)15-8-10(20)9(19)6(2-16)25-13(8)24-5(12(22)23)1-7(17)18/h4-6,8-10,13,16,19-20,26H,1-3,14H2,(H,15,21)(H,17,18)(H,22,23)/t4-,5-,6+,8+,9+,10+,13-/m0/s1 | InChIKey = UHNHELGKNQMNGF-AOQKXWSCBS | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C13H22N2O10S/c14-4(3-26)11(21)15-8-10(20)9(19)6(2-16)25-13(8)24-5(12(22)23)1-7(17)18/h4-6,8-10,13,16,19-20,26H,1-3,14H2,(H,15,21)(H,17,18)(H,22,23)/t4-,5-,6+,8+,9+,10+,13-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = UHNHELGKNQMNGF-AOQKXWSCSA-N }} | Section2 = {{Chembox Properties | Formula = C<sub>13</sub>H<sub>22</sub>N<sub>2</sub>O<sub>10</sub>S | MolarMass = 398.39 g/mol | MeltingPt = | Density = 1.629 g/mL }} | Section3 = | Section4 = | Section5 = | Section6 = }}

'''Bacillithiol''' ('''BSH''' or '''Cys-GlcN-mal''') is a thiol compound found in ''Bacillus'' species.<ref name=Newton>{{Cite journal | doi = 10.1038/nchembio.189 | issn = 1552-4450 | last1 = Newton | volume = 5 | issue = 9 | first1 = G. L. | pages = 625–627 | last2 = Rawat | first2 = M. | last3 = La Clair | first3 = J. J. | last4 = Jothivasan | first4 = V. K. | last5 = Budiarto | first5 = T. | last6 = Hamilton | first6 = C. J. | last7 = Claiborne | first7 = A. | last8 = Helmann | first8 = J. D. | last9 = Fahey | first9 = R. C. | title = Bacillithiol is an antioxidant thiol produced in Bacilli | journal = Nature Chemical Biology | year = 2009 | pmid = 19578333 | pmc = 3510479 }}</ref> It is likely involved in maintaining cellular redox balance and plays a role in microbial resistance to the antibiotic fosfomycin.

==Structure== Chemically, it is a glycoside formed between <small>L</small>-cysteinyl-<small>D</small>-glucosamine and malic acid. It was isolated and identified (as its bacillithiol-S-bimane derivative) in 2009 from ''Staphylococcus aureus'' and ''Deinococcus radiodurans'',<ref name=Newton/> although it was first detected in 2007, as an unidentified thiol in ''Bacillus anthracis''.<ref>{{Cite journal| first1 = I. | last2 = Parsonage | first2 = D. | last4 = Newton | last3 = Paige | last5 = Fahey | first3 = C. | first4 = L. | last7 = Jackowski | last8 = Mallett | first5 = C. | last1 = Nicely | last9 = Claiborne | first6 = R. | last6 = Leonardi | first7 = S. | first8 = C. | first9 = A. | title = STRUCTURE OF THE TYPE III PANTOTHENATE KINASE FROM Bacillus anthracis AT 2.0 Å RESOLUTION: IMPLICATIONS FOR COENZYME A-DEPENDENT REDOX BIOLOGY | journal = Biochemistry | volume = 46 | issue = 11 | pages = 3234–3245 | date=Mar 2007 | issn = 0006-2960 | pmid = 17323930 | pmc = 2613803 | doi = 10.1021/bi062299p }}</ref> The naturally occurring free thiol form of bacillithiol has since been synthesised and characterised along with its biosynthetic precursors and its symmetrical disulfide.<ref name="pmid21751306">{{cite journal |author1=S. V. Sharma |author2=V. K. Jothivasan |author3=G. L. Newton |author4=H. Upton |author5=J. I.Wakabayashi |author6=M. G. Kane |author7=A. A. Roberts |author8=M. Rawat |author9=J. J. La Clair |author10=C. J. Hamilton. |name-list-style=amp |title=Chemical and Chemoenzymatic Syntheses of Bacillithiol: A Unique Low-Molecular-Weight Thiol amongst Low G + C Gram-Positive Bacteria|journal=Angew. Chem. Int. Ed. |volume=50 |issue=31 |pages=7101–7104 |date=July 2011 |pmid=21751306 |doi=10.1002/anie.201100196}}</ref>

==Biological role== Bacillithiol appears to participate in the sensing of peroxides by ''Bacillus'',<ref>{{Cite journal| first1 = W. | last2 = Soonsanga | last3 = Helmann | first2 = S. | first3 = D. | title = A complex thiolate switch regulates the Bacillus subtilis organic peroxide sensor OhrR | journal = Proceedings of the National Academy of Sciences | last1 = Lee | volume = 104 | issue = 21 | pages = 8743–8748 | date=May 2007 | issn = 0027-8424 | pmid = 17502599 | pmc = 1885573 | doi = 10.1073/pnas.0702081104 | bibcode = 2007PNAS..104.8743L | doi-access = free }}</ref> but may also substitute for glutathione, which is the most common intracellular thiol in eukaryotes and some bacteria.<ref name=Newton/> Some of the genes involved in the biosynthesis of bacillithiol were identified and characterised in 2010.<ref name="pmid20308541">{{cite journal |vauthors=Gaballa A, Newton GL, Antelmann H |title=Biosynthesis and functions of bacillithiol, a major low-molecular-weight thiol in Bacilli |journal=Proc. Natl. Acad. Sci. U.S.A. |volume=107 |issue=14 |pages=6482–6 |date=April 2010 |pmid=20308541 |doi=10.1073/pnas.1000928107 |pmc=2851989|bibcode = 2010PNAS..107.6482G |display-authors=etal|doi-access=free }}</ref> Bacteria engineered to be deficient in bacillithiol demonstrated increased sensitivity to various electrophilic xenobiotic compounds, including the antibiotic fosfomycin, suggesting that in these organisms the mechanism of fosfomycin resistance relies on the presence of bacillithiol.<ref name="pmid20308541"/> Furthermore, ''in vitro'' kinetic studies have established that bacillithiol is a preferred thiol substrate for the antibiotic resistance enzyme FosB.<ref name="pmid21751306" /><ref name="pmid23256780">{{cite journal |author1=A. A. Roberts |author2=S. V. Sharma |author3=A. W. Strankman |author4=S. R. Duran |author5=M. Rawat |author6=C. J. Hamilton. |name-list-style=amp |title=Mechanistic studies of FosB: a divalent-metal-dependent bacillithiol-S-transferase that mediates fosfomycin resistance in Staphylococcus aureus|journal=Biochem. J. |volume=451 |issue=1 |pages=69–79 |date=July 2013 |pmid=23256780 |doi=10.1042/BJ20121541 |pmc=3960972}}</ref>

==Biosynthesis== Bacillithiol is produced via the enzymes BshA, BshB, and BshC. BshA replaces the UDP group on UDP-''N''-acetylglucosamine with an <small>L</small>-malyl group. BshB then removes the acetyl group. <small>L</small>-Cysteine is added to the resulting free amine, which completes the biosynthesis of the molecule. The cysteine-adding step is assumed to be carried out by the enzyme BshC on the basis of genetic knockout studies, but the activity of BshC has not been observed ''in vitro''.<ref name="pmid20308541"></ref><ref name="BshCstr">{{cite journal |author1=A. J. VanDuienen |author2=K. R. Winchell |author3=P. D. Cook |name-list-style=amp |title=X-ray Crystallographic Structure of BshC, a Unique Enzyme Involved in Bacillithiol Biosynthesis|journal=Biochemistry |volume=541 |issue=2 |pages=100–103 |date=January 20, 2015 |pmid=25496067 |doi=10.1021/bi501394q |pmc=4303302}}</ref>

== See also == * Mycothiol

== References == {{reflist}}

Category:Thiols Category:Propionamides Category:Dicarboxylic acids Category:Hexosamines