{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 453517835 | Name = BSTFA | ImageFileL1 = BSTFA-2D-skeletal-abbreviated.png | ImageAltL1 = Skeletal formula of BSTFA | ImageSizeL1 = 120 | ImageFileR1 = BSTFA-based-on-similar-xtals-3D-balls.png | ImageAltR1 = Ball-and-stick model of the BSTFA molecule | ImageSizeR1 = 120 | IUPACName = trimethylsilyl 2,2,2-trifluoro-''N''-trimethylsilylethanimidate | OtherNames = BSTFA, ''N'',''O''-Bis(trimethylsilyl)trifluoroacetamide |Section1={{Chembox Identifiers | SMILES = C[Si](C)(C)O\C(\C(F)(F)F)=N\[Si](C)(C)C | CASNo_Ref = {{cascite|correct|??}} | CASNo = 25561-30-2 | PubChem = 94358 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4518443 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 85067 | InChI = 1/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ | InChIKey = XCOBLONWWXQEBS-KPKJPENVBV | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XCOBLONWWXQEBS-KPKJPENVSA-N }} |Section2={{Chembox Properties | C=8 | H=18 | F=3 | N=1 | O=1 | Si=2 | Appearance = colourless liquid | Density = 0.96 | Solubility = | MeltingPtC = -10 | MeltingPt_notes = | BoilingPtC = 45-55 | BoilingPt_notes = 14 mm Hg }} }}

'''''N'',''O''-Bis(trimethylsilyl)trifluoroacetamide''' ('''BSTFA''') is an organosilicon compound. It is a colorless liquid that is very sensitive to traces of water or alcohols.

It is often used to convert hydroxyl groups to trimethylsilyl ether groups (Me = CH<sub>3</sub>): :{{chem2| ROH + CF3C(OSiMe3)NSiMe3 → CF3C(O)NH(SiMe3) + ROSiMe3}}

These silylated derivatives are amenable to analysis or further manipulation. Siloxanes are invariably more volatile than their hydroxyl precursors, and thus they can be more easily analyzed with gas chromatography.<ref>{{cite book |doi=10.1002/047084289X.rn01923 |chapter=N,O-Bis(trimethylsilyl)trifluoroacetamide (BSTFA) |title=Encyclopedia of Reagents for Organic Synthesis |year=2001 |last1=Ito |first1=Katsuji |last2=Nakayama |first2=Yuki |pages=1–4 |isbn=9780470842898 }}</ref>

This reagent was first reported in 1968.<ref>{{cite journal | last1 = Stalling | first1 = DL | last2 = Gehrke | first2 = CW | last3 = Zumwalt | first3 = RW | date = May 1968 | title = A new silylation reagent for amino acids bis(trimethylsilyl)trifluoroacetamide (BSTFA) | url = | journal = Biochemical and Biophysical Research Communications | volume = 31 | issue = 4| pages = 616–22 | pmid = 5656249 }}</ref>

==Related compound== *Bis(trimethylsilyl)acetamide, {{chem2|MeC(OSiMe3)NSiMe3}}

==References== <references/>

Category:Trimethylsilyl compounds