{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 457818666 | IUPAC_name = (5a''S'',6''R'',8a''S'',9''R'',10''S'',12''R'',12a''R'')-10-ethoxy-3,6,9-trimethyldecahydro-3,12-epoxy[1,2]dioxepino[4,3-''i'']isochromene | image = Artemotil.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|artemotil}} | pregnancy_category = not available | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Intramuscular injection
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = Hepatic | elimination_half-life = 20 hours | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|changed|CAS}} | CAS_number = 75887-54-6 | ATC_prefix = P01 | ATC_suffix = BE04 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | PubChem = 3000469 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 2272064 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = XGL7GFB9YI | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 301267
<!--Chemical data--> | C=17 | H=28 | O=5 | smiles = CCO[C@@H]1[C@@H]([C@@H]2CC[C@H]([C@H]3[C@]24[C@H](O1)O[C@@](CC3)(OO4)C)C)C | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16-,17-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = NLYNIRQVMRLPIQ-XQLAAWPRSA-N }} '''Artemotil''' (INN; also known as '''β-arteether'''<ref>{{cite web|url=https://www.who.int/medicines/publications/pharmacopoeia/Artemotil.pdf?ua=1 |accessdate=10 April 2019 |title=The International Pharmacopoeia - Sixth Edition - Artemotil |date=2016}}</ref>), is a fast acting blood schizonticide specifically indicated for the treatment of chloroquine-resistant ''Plasmodium falciparum'' malaria and cerebral malaria cases.<ref name="Yeates_2002">{{cite journal | vauthors = Yeates RA | title = Artemotil Artecef | journal = Current Opinion in Investigational Drugs | location = London, England | volume = 3 | issue = 4 | pages = 545–9 | date = April 2002 | pmid = 12090721 | doi = | url = }}</ref> It is a semi-synthetic derivative of artemisinin, a natural product of the Chinese plant ''Artemisia annua''. It is currently only used as a second line drug in severe cases of malaria.
==References== {{Reflist}}
{{Antimalarials}}
Category:Antimalarial agents Category:Ethers Category:Organic peroxides Category:Sesquiterpenes Category:Trioxanes Category:Ethoxy compounds Category:Heterocyclic compounds with 4 rings {{antimicrobial-stub}}