{{Chembox |Section1={{Chembox Identifiers | index1_label=1- | index2_label=2- | index3_label=9- | index4_label=1,2- | index5_label=1,2,3- | QID1 = Q27117030 | QID2 = Q27117031 | QID4 = Q27149391 | PubChem1=123077 | PubChem2=99503 | PubChem3=10731 | PubChem4=155464 | PubChem5 = 22491594 | ChemSpiderID1 = 109698 | ChemSpiderID2 = 89896 | ChemSpiderID3 = 10278 | ChemSpiderID4 = 136955 | EC_number1 = 275-152-6 | ChEMBL1 = 3277318 | ChEBI1 = 37090 | ChEBI2 = 37091 | ChEBI3 = 40753 | ChEBI4 = 80376 | CASNo1 = 610-50-4 | CASNo2 = 613-14-9 | CASNo3 = 529-86-2 | CASNo4 = 577-95-7 | CASNo5 = 109439-88-5 | UNII1 = 6W78ZMQ2ZT | UNII2 = A1C592Z5Y5 | UNII3 = 15PF96Z0OC | Beilstein = 1869102 <!--| Beilstein2 = 1910178 | Beilstein3 = 1869416 --> | Gmelin = 185412 | KEGG4 = C16204 | InChI1=1S/C14H10O/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9,15H | InChI3=1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15H | InChIKey3 = AUKRYONWZHRJRE-UHFFFAOYSA-N | SMILES3 = C1=CC=C2C(=C1)C=C3C=CC=CC3=C2O | InChI2=1S/C14H10O/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9,15H | InChIKey2 = BQBWUVWMUXGILF-UHFFFAOYSA-N | SMILES2 = C1=CC=C2C=C3C=C(C=CC3=CC2=C1)O | InChIKey1 = MUVQKFGNPGZBII-UHFFFAOYSA-N | SMILES1 = C1=CC=C2C=C3C(=CC2=C1)C=CC=C3O | InChI4=1S/C14H10O2/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16/h1-8,15-16H | InChIKey4 = UTCOUOISVRSLSH-UHFFFAOYSA-N | SMILES4 = C1=CC=C2C=C3C(=CC2=C1)C=CC(=C3O)O | InChI5=1S/C14H10O3/c15-12-7-10-5-8-3-1-2-4-9(8)6-11(10)13(16)14(12)17/h1-7,15-17H | InChIKey5 = SLOLMTWBBAFOKJ-UHFFFAOYSA-N | SMILES5 = C1=CC=C2C=C3C(=CC2=C1)C=C(C(=C3O)O)O }} }} '''Anthrols''' (sometimes called '''anthranols''') are the hydroxylated derivatives of anthracene. For the monohydroxo derivatives, three isomers are possible: 1-anthrol, 2-anthrol, and 9-anthrol. The latter exists as a minor tautomer of 9-anthrone.
{| class="sortable wikitable" |+Monohydroxo isomers |- ! Name ! CAS ! colspan=2 | Melting point ! Structure |- | 1-anthrol, 1-hydroxyanthracene | 610-50-4 | {{cvt|150|C|F|disp=table|abbr=on}} | 135px |- | 2-anthrol, 2-hydroxyanthracene | 613-14-9 | {{cvt|166|C|F|disp=table|abbr=on}} |172px |- | 9-anthrol, 9-hydroxyanthracene<ref>{{cite journal|doi=10.1021/jo052615q|pmid=16674042|title=Tautomeric Equilibria and Pi Electron Delocalization for Some Monohydroxyarenes ''Quantum'' Chemical Studies|journal=The Journal of Organic Chemistry|volume=71|issue=10|pages=3727–3736|year=2006|last1=Ośmiałowski|first1=Borys|last2=Raczyńska|first2=Ewa D.|last3=Krygowski|first3=Tadeusz M.}}</ref> | 529-86-2 | {{cvt|152|C|F|disp=table|abbr=on}} |135px |- |} ==References== {{Reflist}}
Category:Anthracenes Category:Hydroxyarenes