{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Drugbox | Watchedfields = changed | verifiedrevid = 443275125 | IUPAC_name = 5-amino-2-[2-(dimethylamino)ethyl]-1''H''-benzo[''de'']isoquinoline-1,3(2''H'')-dione | image = Amonafide.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = Xanafide, Quinamed | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 69408-81-7 | ATC_prefix = none | ATC_suffix = | PubChem = 50515 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 45804 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 1Q8D39N37L | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 428676 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D10090
<!--Chemical data--> | C=16 | H=17 | N=3 | O=2 | smiles = O=C2c1c3c(ccc1)cc(cc3C(=O)N2CCN(C)C)N | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H17N3O2/c1-18(2)6-7-19-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(19)21/h3-5,8-9H,6-7,17H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = UPALIKSFLSVKIS-UHFFFAOYSA-N }} '''Amonafide''' (originally AS1413) (INN, trade names '''Quinamed''' and '''Xanafide''') was a drug that was being studied in the treatment of cancer. It belongs to a novel family of chemotherapeutic drugs called Naphthalimides and is a potential topoisomerase inhibitor and DNA intercalator.<ref name="Allen_2011">{{cite journal | vauthors = Allen SL, Lundberg AS | title = Amonafide: a potential role in treating acute myeloid leukemia | journal = Expert Opinion on Investigational Drugs | volume = 20 | issue = 7 | pages = 995–1003 | date = July 2011 | pmid = 21591994 | doi = 10.1517/13543784.2011.585756 | s2cid = 10999582 }}</ref><ref name="Freeman_2012">{{cite journal | vauthors = Freeman CL, Swords R, Giles FJ | title = Amonafide: a future in treatment of resistant and secondary acute myeloid leukemia? | journal = Expert Review of Hematology | volume = 5 | issue = 1 | pages = 17–26 | date = February 2012 | pmid = 22272701 | doi = 10.1586/ehm.11.68 | s2cid = 26740617 }}</ref>
It was being developed as an anti-cancer therapy by Antisoma.<ref>{{cite web | title = Antisoma's Shares Plummet 70% as Cancer Candidate Bombs in Phase III NSCLC Trial | url = http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-url = https://web.archive.org/web/20100401235144/http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-date = 1 April 2010 | date = 29 March 2010 | work = Genetic Engineering & Biotechnology News }}</ref>
{{As of|2008}}, it is in Phase III clinical trials. e.g. In March 2010 it is Phase III trial against secondary acute myeloid leukaemia (AML).<ref>{{ClinicalTrialsGov|NCT00715637|Phase III Randomized Study of Amonafide (AS1413) and Cytarabine Versus Daunorubicin and Cytarabine in Patients With Secondary Acute Myeloid Leukemia (AML)- the ACCEDE Study}}</ref> In June 2010, it gained an FDA Fast Track Status for the treatment of Secondary Acute Myeloid Leukaemia.{{cn|date=February 2023}}
==See also== * Alrestatin
==References== {{reflist}}
== External links == * [http://www.cancer.gov/dictionary?CdrID=350223 Amonafide] entry in the public domain NCI Dictionary of Cancer Terms * [http://www.clinicaltrials.gov/ct2/results?term=amonafide Clinical trials of amonafide] at ClinicalTrials.gov
{{NCI-cancer-dict}}
Category:Experimental cancer drugs
{{antineoplastic-drug-stub}}