| Verifiedrevid | 450346127 |
|---|---|
| Iupac name | 9-(2-diethylaminoethoxy)-4-hydroxy-7-methylpyrano[3,2-f][1]benzoxol-5-one |
| Metabolism | none |
| Cas number | 4439-67-2 |
| Atc prefix | none |
| Chembl | 2104025 |
| Pubchem | 71198 |
| Chemspiderid | 64334 |
| Unii | BD9T227F6M |
| C | 18 |
| H | 21 |
| N | 1 |
| O | 5 |
| Smiles | O=C/1c3c(O\C(=C\1)C)c(OCCN(CC)CC)c2occc2c3O |
| Stdinchi | 1S/C18H21NO5/c1-4-19(5-2)7-9-23-18-16-12(6-8-22-16)15(21)14-13(20)10-11(3)24-17(14)18/h6,8,10,21H,4-5,7,9H2,1-3H3 |
| Stdinchikey | QZBPFSZZMYTRIA-UHFFFAOYSA-N |
Amikhelline is an antimitotic drug.[1] It acts as a DNA intercalator[2] and inhibits DNA polymerase.[3]
References
- ^ Turchini MF, Geneix A, Perissel B, Malet P, Turchini JP (1985). "[Characterization of chromosomal aberrations induced in man by various antimitotic agents]". Comptes Rendus des Séances de la Société de Biologie et de ses Filiales. 179 (3): 331–9. PMID 2417673
- ^ Rucheton M, Jeanteur P (1973). "Studies on amikhellin. I. Intercalative binding to double-stranded DNA". Biochimie. 55 (11): 1415–20. doi:10.1016/s0300-9084(74)80548-1. PMID 4364376
- ^ Rucheton M, Jeanteur P (1976). "Studies on amikhellin. II.-Inhibition of dna-polymerase from murine sarcoma leukemia virus". Biochimie. 58 (6): 689–95. doi:10.1016/s0300-9084(76)80393-8. PMID 60141