{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | INN = | type = <!-- empty --> | image = Amcenestrant.svg | image_class = skin-invert-image | width = | alt = | caption = | image2 = | width2 = | alt2 = | caption2 = | imageL = | widthL = | altL = | imageR = | widthR = | altR = | captionLR =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = <!-- Health Canada may use generic or brand name (generic name preferred) --> | licence_EU = <!-- EMA uses INN (or special INN_EMA) --> | DailyMedID = <!-- DailyMed may use generic or brand name (generic name preferred) --> | licence_US = <!-- FDA may use generic or brand name (generic name preferred) --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU_comment = | pregnancy_category= | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATCvet = | ATC_prefix = <!-- 'none' if uncategorised --> | ATC_suffix = | ATC_supplemental =
<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C5, D1, D2, E, F1, F2, F3, F4 --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | legal_UK_comment = | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | legal_UN_comment = | legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action= | excretion =
<!-- Identifiers --> | CAS_number = 2114339-57-8 | CAS_supplemental = | PubChem = 130232326 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = DB17864 | ChemSpiderID = 76117729 | UNII = TBF1NHY02O | KEGG = D12145 | ChEBI = | ChEMBL = 4475463 | NIAID_ChemDB = | PDB_ligand = | synonyms =
<!-- Chemical and physical data --> | IUPAC_name = <nowiki>6-(2,4-dichlorophenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid</nowiki> | C= 31 | H= 30 | Cl= 2 | F= 1 | N= 1 | O= 3 | molecular_weight = | SMILES = C1CC2=C(C=CC(=C2)C(=O)O)C(=C(C1)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)O[C@H]5CCN(C5)CCCF | Jmol = | StdInChI = InChI=1S/C31H30Cl2FNO3/c32-23-8-12-27(29(33)18-23)28-4-1-3-21-17-22(31(36)37)7-11-26(21)30(28)20-5-9-24(10-6-20)38-25-13-16-35(19-25)15-2-14-34/h5-12,17-18,25H,1-4,13-16,19H2,(H,36,37)/t25-/m0/s1 | StdInChI_comment = | StdInChIKey = KISZAGQTIXIVAR-VWLOTQADSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} '''Amcenestrant''' is a novel oral selective estrogen receptor degrader (SERD) that is being evaluated for the treatment of estrogen receptor-positive (ER+) breast cancer.<ref name="Liang">{{cite journal | vauthors = Liang J, Zbieg JR, Blake RA, Chang JH, Daly S, DiPasquale AG, Friedman LS, Gelzleichter T, Gill M, Giltnane JM, Goodacre S, Guan J, Hartman SJ, Ingalla ER, Kategaya L, Kiefer JR, Kleinheinz T, Labadie SS, Lai T, Li J, Liao J, Liu Z, Mody V, McLean N, Metcalfe C, Nannini MA, Oeh J, O'Rourke MG, Ortwine DF, Ran Y, Ray NC, Roussel F, Sambrone A, Sampath D, Schutt LK, Vinogradova M, Wai J, Wang T, Wertz IE, White JR, Yeap SK, Young A, Zhang B, Zheng X, Zhou W, Zhong Y, Wang X | title = GDC-9545 (Giredestrant): A Potent and Orally Bioavailable Selective Estrogen Receptor Antagonist and Degrader with an Exceptional Preclinical Profile for ER+ Breast Cancer | journal = Journal of Medicinal Chemistry | volume = 64 | issue = 16 | pages = 11841–11856 | date = August 2021 | pmid = 34251202 | doi = 10.1021/acs.jmedchem.1c00847 }}</ref>
Phase III trial for breast cancer in Japan had started, but this trial has been discontinued.<ref>{{cite web |title=Amcenestrant - Sanofi |url=https://adisinsight.springer.com/drugs/800048980 | work = AdisInsight |publisher=Springer Nature Switzerland AG }}</ref>
== References == {{Reflist}}
== Further reading == {{refbegin}} * {{cite journal | vauthors = Gheysen M, Punie K, Wildiers H, Neven P | title = Oral SERDs changing the scenery in hormone receptor positive breast cancer, a comprehensive review | journal = Cancer Treatment Reviews | volume = 130 | issue = | article-number = 102825 | date = November 2024 | pmid = 39293125 | doi = 10.1016/j.ctrv.2024.102825 | doi-access = free }} * {{cite journal | vauthors = Guglielmi G, Del Re M, Gol LS, Bengala C, Danesi R, Fogli S | title = Pharmacological insights on novel oral selective estrogen receptor degraders in breast cancer | journal = European Journal of Pharmacology | volume = 969 | issue = | article-number = 176424 | date = April 2024 | pmid = 38402929 | doi = 10.1016/j.ejphar.2024.176424 | doi-access = free | hdl = 2434/1128718 | hdl-access = free }} * {{cite journal | vauthors = Garcia-Fructuoso I, Gomez-Bravo R, Schettini F | title = Integrating new oral selective oestrogen receptor degraders in the breast cancer treatment | journal = Current Opinion in Oncology | volume = 34 | issue = 6 | pages = 635–642 | date = November 2022 | pmid = 36000362 | doi = 10.1097/CCO.0000000000000892 }} * {{cite journal | vauthors = Chen YC, Yu J, Metcalfe C, De Bruyn T, Gelzleichter T, Malhi V, Perez-Moreno PD, Wang X | title = Latest generation estrogen receptor degraders for the treatment of hormone receptor-positive breast cancer | journal = Expert Opinion on Investigational Drugs | volume = 31 | issue = 6 | pages = 515–529 | date = June 2022 | pmid = 34694932 | doi = 10.1080/13543784.2021.1983542 | doi-access = free }} {{refend}}
{{antineoplastic-drug-stub}}
Category:Selective estrogen receptor degraders Category:Benzoic acids Category:Chlorobenzene derivatives Category:Bicyclic compounds Category:Organofluorides Category:Phenols Category:Pyrrolidines Category:Phenol ethers