{{Short description|Antidepressant and anxiolytic drug}} {{drugbox | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 34E28BM822 | verifiedrevid = 444427189 | IUPAC_name = (+)-4-dihydro-2''H''-chromen-3-yl]-propylamino]butyl]-8-azaspiro[4.5]decane-7,9-dione | image = Alnespirone.svg | image_class = skin-invert-image | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = QYFHCFNBYQZGKW-BDQAORGHSA-N | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 138298-79-0 | ATC_prefix = none | ATC_suffix = | PubChem = 178132 | ChEMBL = 2104091 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 8002134 | C = 26 | H = 38 | N = 2 | O = 4 | smiles = Cl.O=C1N(C(=O)CC2(C1)CCCC2)CCCCN([C@H]3Cc4c(OC)cccc4OC3)CCC | bioavailability = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration = }}
'''Alnespirone''' ('''S-20,499''') is a selective 5-HT<sub>1A</sub> receptor full agonist of the azapirone chemical class.<ref name="pmid1351756">{{cite journal | doi = 10.1097/00001756-199201000-00022 | vauthors = Griebel G, Misslin R, Pawlowski M, Guardiola Lemaître B, Guillaumet G, Bizot-Espiard J | title = Anxiolytic-like effects of a selective 5-HT1A agonist, S20244, and its enantiomers in mice. | journal = NeuroReport | volume = 3 | issue = 1 | pages = 84–86 | year = 1992 | pmid = 1351756 }}</ref><ref name="pmid1357709">{{cite journal | doi = 10.1007/BF02245284 | vauthors = Simon P, Guardiola B, Bizot-Espiard J, Schiavi P, Costentin J | title = 5-HT1A receptor agonists prevent in rats the yawning and penile erections induced by direct dopamine agonists. | journal = Psychopharmacology | volume = 108 | issue = 1–2 | pages = 47–50 | year = 1992 | pmid = 1357709 | s2cid = 22385029 }}</ref><ref name="pmid12505530">{{cite journal | doi = 10.1016/S0014-2999(02)02814-5 | vauthors = Astier B, Lambás Señas L, Soulière F, Schmitt P, Urbain N, Rentero N, Bert L, Denoroy L, Renaud B, Lesourd M, Muñoz C, Chouvet G | title = In vivo comparison of two 5-HT1A receptors agonists alnespirone (S-20499) and buspirone on locus coeruleus neuronal activity. | journal = Eur J Pharmacol | volume = 459 | issue = 1 | pages = 17–26 | year = 2003 | pmid = 12505530 }}</ref> It produces antidepressant, anxiolytic, and antiaggressive effects.<ref name="pmid1351756" /><ref name="deBoerKoolhaas2005">{{cite journal | vauthors = de Boer SF, Koolhaas JM | title = 5-HT1A and 5-HT1B receptor agonists and aggression: a pharmacological challenge of the serotonin deficiency hypothesis | journal = Eur J Pharmacol | volume = 526 | issue = 1-3 | pages = 125–139 | date = December 2005 | pmid = 16310183 | doi = 10.1016/j.ejphar.2005.09.065 | url = }}</ref>
== See also == * 8-OH-DPAT
== References == {{Reflist}}
{{Serotonin receptor modulators}} {{Piperazines}}
Category:Antiaggressive drugs Category:Azapirones Category:Chromanes Category:Cyclic ethers Category:Cyclopentanes Category:Imides Category:Lactams Category:Methoxy compounds Category:2-Phenoxyethanamines Category:Propyl compounds Category:Resorcinol ethers Category:Serotonin receptor agonists Category:Spiro compounds Category:Tertiary amines
{{Amine-stub}} {{Anxiolytic-stub}} Category:3-Aminochromans