{{Chembox | Name = | ImageFile = acifran.svg | ImageSize = 150px | IUPACName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid | SystematicName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid | OtherNames = |Section1={{Chembox Identifiers | IUPHAR_ligand = 1595 | Abbreviations = | CASNo = 72420-38-3 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = B1X701S0MV | EINECS = | PubChem = 51576 | ChemSpiderID = 46712 | ChEMBL = 278488 | SMILES = CC1(C(=O)C=C(O1)C(=O)O)C2=CC=CC=C2 | InChI = 1/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15) | InChIKey = DFDGRKNOFOJBAJ-UHFFFAOYAE | StdInChI = 1S/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15) | StdInChIKey = DFDGRKNOFOJBAJ-UHFFFAOYSA-N | RTECS = | MeSHName = | ChEBI = | KEGG = D02753 }} |Section2={{Chembox Properties | C=12 | H=10 | O=4 | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = }} |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | PregCat = | PregCat_AU = | PregCat_US = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = }} }}
'''Acifran''' is a niacin receptor agonist.<ref>{{cite journal | pmid = 17358052 | title = Analogues of acifran: agonists of the high and low affinity niacin receptors, GPR109a and GPR109b | doi=10.1021/jm070022x | volume=50 | issue=7 | date=April 2007 | journal=J. Med. Chem. | pages=1445–8| last1 = Jung | first1 = J. K. | last2 = Johnson | first2 = B. R. | last3 = Duong | first3 = T | last4 = Decaire | first4 = M | last5 = Uy | first5 = J | last6 = Gharbaoui | first6 = T | last7 = Boatman | first7 = P. D. | last8 = Sage | first8 = C. R. | last9 = Chen | first9 = R | last10 = Richman | first10 = J. G. | last11 = Connolly | first11 = D. T. | last12 = Semple | first12 = G }}</ref>
==References== {{reflist}}
Category:Receptor agonists Category:Carboxylic acids Category:Enones
{{OrganicAcid-stub}}