{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = Aleph-6 v2.svg | image_class = skin-invert-image | width = 250px | image2 = Aleph-6 ball-and-stick structure.png | image_class2 = bg-transparent | width2 = 215px
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = Oral<ref name="PiHKAL" /> | class = Serotonergic psychedelic; Hallucinogen | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = "Probably long" (at least 12{{nbsp}}hours)<ref name="PiHKAL" /> | excretion =
<!-- Identifiers --> | CAS_number = 952006-44-9 | CAS_supplemental = | PubChem = 44719475 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 23552980 | UNII = 3961V7J60A | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = ALEPH-6; DOT-6; 4-Phenylthio-2,5-dimethoxyamphetamine; 2,5-Dimethoxy-4-phenylthioamphetamine; 4-PhS-DMA
<!-- Chemical data --> | IUPAC_name = 1-(2,5-dimethoxy-4-phenylsulfanylphenyl)propan-2-amine | C=17 | H=21 | N=1 | O=2 | S=1 | SMILES = CC(CC1=CC(=C(C=C1OC)SC2=CC=CC=C2)OC)N | StdInChI = 1S/C17H21NO2S/c1-12(18)9-13-10-16(20-3)17(11-15(13)19-2)21-14-7-5-4-6-8-14/h4-8,10-12H,9,18H2,1-3H3 | StdInChIKey = CSOTVYXYZSJOFL-UHFFFAOYSA-N }}
'''Aleph-6''', or '''ALEPH-6''', also known as '''4-phenylthio-2,5-dimethoxyamphetamine''', is a psychedelic drug of the phenethylamine, amphetamine, and DOx families.<ref name="PiHKAL">{{CitePiHKAL }} https://erowid.org/library/books_online/pihkal/pihkal006.shtml</ref><ref name="Shulgin_2011">{{cite book | vauthors = Shulgin A, Manning T, Daley P | title = The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds | location = Berkeley | volume = 1 | year = 2011 | publisher = Transform Press | isbn = 978-0-9630096-3-0 }}</ref><ref name="Shulgin_2003">{{cite book | vauthors = Shulgin AT | veditors = Laing RR | chapter = Basic Pharmacology and Effects | title = Hallucinogens: A Forensic Drug Handbook | pages = 67–137 | year = 2003 | publisher = Elsevier Science | series = Forensic Drug Handbook Series | isbn = 978-0-12-433951-4 | url = https://books.google.com/books?id=l1DrqgobbcwC | chapter-url = https://bibliography.maps.org/resources/download/12634 | archive-url = https://web.archive.org/web/20250713013624/https://bibliography.maps.org/resources/download/12634 | archive-date = 13 July 2025 }}</ref> It is one of the Aleph series of compounds.<ref name="PiHKAL" /><ref name="Shulgin_2011" /><ref name="Shulgin_2003" />
In his book ''PiHKAL'' (''Phenethylamines I Have Known and Loved''), Alexander Shulgin lists Aleph-6's dose as greater than 40{{nbsp}}mg orally and its duration as "probably long".<ref name="PiHKAL" /><ref name="Shulgin_2011" /><ref name="Shulgin_2003" /> The effects of Aleph-6 have been reported to include "un-worldliness", among others.<ref name="PiHKAL" /> It was reported to have synergized with LSD when taken in combination with it.<ref name="PiHKAL" /> Overall however, Shulgin regarded Aleph-6 as a "disappointment" and that it may be a "forever threshold thing".<ref name="PiHKAL" />
The chemical synthesis of Aleph-6 has been described.<ref name="PiHKAL" /><ref name="Shulgin_2011" /> The 2C analogue, 2C-T-6, has never been synthesized.<ref name="PiHKAL" />
Aleph-6 was first described in the literature by Shulgin in ''PiHKAL'' in 1991.<ref name="PiHKAL" /><ref name="Shulgin_2011" /><ref name="Shulgin_2003" /> It is a controlled substance in Canada under phenethylamine blanket-ban language.<ref name="CDSA">{{cite web | title=Controlled Drugs and Substances Act | website=Department of Justice Canada | url=https://laws-lois.justice.gc.ca/eng/acts/c-38.8/FullText.html | access-date=19 January 2026}}</ref>
== See also == * DOx (psychedelics) * Aleph (psychedelics)
== References == {{Reflist}}
== External links == * [https://isomerdesign.com/pihkal/explore/6 Aleph-6 - Isomer Design] * [https://erowid.org/library/books_online/pihkal/pihkal006.shtml Aleph-6 - PiHKAL - Erowid] * [https://isomerdesign.com/pihkal/read/pk/6 Aleph-6 - PiHKAL - Isomer Design] * [https://tripsitter.com/amphetamines/aleph-6/ Aleph-6: Pharmacology, Side Effects, & Characteristics - Tripsitter] * [https://www.youtube.com/watch?v=qKm4fnYYRG0 Thioethers from PIHKAL, 2-C-T and ALEPH series - Fenderson5555 - YouTube]
{{Psychedelics}} {{Phenethylamines}}
Category:DOx (psychedelics) Category:Phenylthio compounds Category:PiHKAL Category:Psychedelic phenethylamines
{{Hallucinogen-stub}}