{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = Sofinicline structure.svg | image_class = skin-invert-image | width = 250px | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = Oral<ref name="AdisInsight" /><ref name="FleisherMcGough2014" /> | class = α<sub>4</sub>β<sub>2</sub> nicotinic acetylcholine receptor agonist | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = 2–4 hours ({{Abbrlink|T<sub>max</sub>|time to peak levels}})<ref name="FleisherMcGough2014" /> | elimination_half-life = 4–6 hours<ref name="FleisherMcGough2014" /> | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = 799279-80-4 | CAS_supplemental = | PubChem = 10131048 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = DB12527 | ChemSpiderID = 8306563 | UNII = SQC232V4YY | KEGG = D09382 | ChEBI = | ChEMBL = 238465 | NIAID_ChemDB = | PDB_ligand = | synonyms = ABT-894; ABT894; A-422894.0
<!-- Chemical data --> | IUPAC_name = (1''S'',5''S'')-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane | C=10 | H=11 | Cl=2 | N=3 | SMILES = C1[C@H]2CN(C[C@H]2N1)C3=CC(=C(N=C3)Cl)Cl | StdInChI = 1S/C10H11Cl2N3/c11-8-1-7(3-14-10(8)12)15-4-6-2-13-9(6)5-15/h1,3,6,9,13H,2,4-5H2/t6-,9+/m0/s1 | StdInChIKey = MBQYQLWSBRANKQ-IMTBSYHQSA-N }}
'''Sofinicline''' ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|USAN|United States Adopted Name}}; developmental code names '''ABT-894''' and '''A-422894.0''') is a nicotinic acetylcholine receptor (nAChR) agonist which was under development for the treatment of attention deficit hyperactivity disorder (ADHD), cognition disorders, and diabetic neuropathies but was never marketed.<ref name="AdisInsight">{{cite web | title=Sofinicline | website=AdisInsight | date=23 January 2013 | url=https://adisinsight.springer.com/drugs/800019709 | access-date=28 May 2026}}</ref><ref name="Synapse">{{cite web | title=Delving into the Latest Updates on Sofinicline with Synapse | website=Synapse | date=16 May 2026 | url=https://synapse.patsnap.com/drug/dd00d583ceca438d960c4c74d28b467d | access-date=28 May 2026}}</ref><ref name="FleisherMcGough2014">{{cite journal | vauthors = Fleisher C, McGough J | title = Sofinicline: a novel nicotinic acetylcholine receptor agonist in the treatment of attention-deficit/hyperactivity disorder | journal = Expert Opinion on Investigational Drugs | volume = 23 | issue = 8 | pages = 1157–1163 | date = August 2014 | pmid = 24965900 | doi = 10.1517/13543784.2014.934806 | url = }}</ref> It is taken orally.<ref name="AdisInsight" /><ref name="FleisherMcGough2014" />
The drug acts as a highly selective full agonist of the α<sub>4</sub>β<sub>2</sub> nicotinic acetylcholine receptor.<ref name="FleisherMcGough2014" /> It has been found to enhance cognition and memory in rodents.<ref name="FleisherMcGough2014" /> Sofinicline's affinity for the receptor is approximately 0.1{{nbsp}}nM.<ref name="FleisherMcGough2014" /> The time to peak levels of sofinicline is 2 to 4{{nbsp}}hours and its elimination half-life is 4 to 6{{nbsp}}hours.<ref name="FleisherMcGough2014" /> Other pharmacokinetic data for sofinicline have also been reported.<ref name="FleisherMcGough2014" /> Side effects of sofinicline in humans include increased heart rate, nausea, dizziness, headache, and fatigue.<ref name="FleisherMcGough2014" />
Sofinicline was under development by Abbott Laboratories and NeuroSearch.<ref name="AdisInsight" /><ref name="Synapse" /> It reached phase 2 clinical trials for ADHD and neuropathic pain and the preclinical research stage of development for cognition disorders prior to the discontinuation of its development.<ref name="AdisInsight" /><ref name="Synapse" />
== See also == * List of investigational attention deficit hyperactivity disorder drugs * List of investigational analgesics
== References == {{Reflist}}
{{Nicotinic acetylcholine receptor modulators}}
Category:Abandoned drugs Category:Chloroarenes Category:Nicotinic agonists Category:Pyridines