{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 399345932 | IUPAC_name = (8aS,12aR)-2-(4-isopropoxy-2-(trifluoromethyl)phenyl)-6,7,8a,9,10,11,12,12a-octahydro-5H-[1,4]oxazepino[2,3,4-hi]pyrido[4,3-b]indole | image = A-372159.svg | image_class = skin-invert-image | width = 220

<!--Clinical data--> | tradename = | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 313543-60-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = NK36K7QB8G | PubChem = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 9605283

<!--Chemical data--> | C=24 | H=27 | F=3 | N=2 | O=2 | smiles = FC(F)(C1=C(C2=CC3=C4C(OCCCN4[C@@]5([H])CCNC[C@@]35[H])=C2)C=CC(OC(C)C)=C1)F | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C24H27F3N2O2/c1-14(2)31-16-4-5-17(20(12-16)24(25,26)27)15-10-18-19-13-28-7-6-21(19)29-8-3-9-30-22(11-15)23(18)29/h4-5,10-12,14,19,21,28H,3,6-9,13H2,1-2H3/t19-,21-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LADKOBQJOCFCQU-FPOVZHCZSA-N }}

'''A-372159''' is a drug which acts as a potent and selective partial agonist for the 5HT<sub>2C</sub> receptor, with more than 100x selectivity over the closely related 5-HT<sub>2B</sub> receptor and a Ki of 3nM. It has been found to produce anorectic effects in animal studies and produced significant weight loss in rats with no development of tolerance or serious side effects.<ref>{{cite journal | vauthors = Childers WE, Robichaud AJ | title = Recent advances in selective serotonergic agents. | journal = Annual Reports in Medicinal Chemistry | date = January 2005 | volume = 40 | pages = 17–33 | doi = 10.1016/S0065-7743(05)40002-0 | isbn = 978-0-12-040540-4 | url = https://books.google.com/books?id=SS72YOYTIHQC&pg=PA17 | url-access = subscription }}</ref>

==References== {{Reflist}}

{{Serotonergics}}

Category:Serotonin receptor agonists Category:4-Hydroxybiphenyl ethers Category:Trifluoromethyl compounds Category:Piperidines Category:Cyclic ethers Category:Isopropyl compounds

{{nervous-system-drug-stub}}