{{Chembox <!-- Images -->| Name = | ImageFile = Phenanthren-9-ol.svg | ImageSize = | ImageAlt = <!-- Names --> | IUPACName = 9-Phenanthrol | OtherNames = {{Unbulleted list|9-Phenanthrol|9-Phenanthrenol|Phenanthren-9-ol|9-Hydroxyphenanthrene }} | SystematicName = 9-Hydroxyphenanthrene | Section1 = {{Chembox Identifiers | CASNo = 484-17-3 | CASNo_Ref = {{cascite|correct|CAS}} | UNII = 9FYU45OV9H | UNII_Ref = {{fdacite|correct|FDA}} | PubChem = 10229 | EC_number = 207-602-4 | ChemSpiderID = 9812 | ChEMBL = 2407182 | ChEBI = 28820 | KEGG = C11430 | StdInChI=1S/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H | StdInChIKey = DZKIUEHLEXLYKM-UHFFFAOYSA-N | SMILES = C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)O }} | Section2 = {{Chembox Properties | C=14|H=10|O=1 }} | Section3 = | Section4 = | Section5 = | Section6 = {{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} }} }} '''9-Phenanthrol''' is an aromatic alcohol derived from phenanthrene, a tricyclic compound. It is a TRPM4 channel inhibitor.<ref>{{Cite journal|last1=Guinamard|first1=R|last2=Hof|first2=T|last3=Del Negro|first3=C A|year=2014|title=The TRPM4 channel inhibitor 9-phenanthrol|journal=British Journal of Pharmacology|volume=171|issue=7|pages=1600–1613|doi=10.1111/bph.12582|pmid=24433510|pmc=3966741}}</ref> It can prevent the pancreas from secreting insulin when stimulated by glucose.<ref>{{cite journal |last1=Ma |first1=Zuheng |last2=Björklund |first2=Anneli |last3=Islam |first3=Md. Shahidul |title=A TRPM4 Inhibitor 9-Phenanthrol Inhibits Glucose- and Glucagon-Like Peptide 1-Induced Insulin Secretion from Rat Islets of Langerhans |journal=Journal of Diabetes Research |date=2017 |volume=2017 |pages=1–5 |doi=10.1155/2017/5131785|pmid=29098165 |pmc=5643033 |doi-access=free }}</ref>

==References== {{Reflist}}

{{DEFAULTSORT:Phenanthrol}} Category:Hydroxyarenes Category:Phenanthrenoids